CAS 53137-27-2
:2,4-Dimethylthiazole-5-carboxylic acid
Description:
2,4-Dimethylthiazole-5-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features two methyl groups at the 2 and 4 positions of the thiazole ring and a carboxylic acid functional group at the 5 position, contributing to its acidic properties. It is typically a white to off-white crystalline solid, soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure allows for various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the thiazole moiety may impart specific biological properties, which can be explored in drug development or as a biochemical probe. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H6NO2S
InChI:InChI=1/C6H7NO2S/c1-3-5(6(8)9)10-4(2)7-3/h1-2H3,(H,8,9)/p-1
SMILES:Cc1c(C(=O)[O-])sc(C)n1
Synonyms:- 2,4-Dimethyl-1,3-thiazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Dimethylthiazole-5-carboxylic Acid
CAS:Formula:C6H7NO2SPurity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:157.192,4-Dimethylthiazole-5-Carboxylic Acid
CAS:Formula:C6H7NO2SPurity:98%Color and Shape:SolidMolecular weight:157.19032,4-Dimethyl-1,3-thiazole-5-carboxylic acid
CAS:2,4-Dimethyl-1,3-thiazole-5-carboxylic acidFormula:C6H7NO2SPurity:98%Color and Shape: off-white solidMolecular weight:157.19g/mol2,4-Dimethylthiazole-5-carboxylic acid
CAS:Formula:C6H7NO2SPurity:98%Color and Shape:SolidMolecular weight:157.192,4-Dimethylthiazole-5-carboxylic Acid
CAS:2,4-Dimethylthiazole-5-carboxylic Acid is a class of organic compounds that are used as a building block for the synthesis of polymers. The surface analysis of this compound reveals that it is a supramolecular polymer with an irregular crystal structure. This compound can be synthesized from 2,4-dimethylthiazol and 5-carboxylic acid in two steps. The X-ray diffraction analysis shows that the crystalline form is single and belongs to the orthorhombic system with space group Pbnm. Hydrogen bonds between the aromatic rings and carboxylate esters are present. This polymer has been shown to be active against graminis sclerotiorum and Sclerotinia graminicola.Formula:C6H7NO2SPurity:Min. 95%Molecular weight:157.19 g/mol




