CAS 53167-38-7
:N-[(2R,3S,4R,5S)-2-benzyloxy-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]acetamide
Description:
The chemical substance N-[(2R,3S,4R,5S)-2-benzyloxy-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]acetamide, with CAS number 53167-38-7, is a complex organic compound characterized by its multiple hydroxyl groups and sugar-like structures, which suggest it may exhibit significant solubility in polar solvents. The presence of benzyloxy and acetamide functional groups indicates potential for various chemical reactivity, including hydrogen bonding and interactions with biological systems. This compound is likely to be a glycoside or a derivative of a carbohydrate, which may impart specific biological activities, such as enzyme inhibition or modulation of metabolic pathways. Its stereochemistry, indicated by the R and S designations, suggests that it may have specific spatial configurations that could influence its biological interactions and pharmacological properties. Overall, this compound's structural complexity and functional groups make it a candidate for further investigation in medicinal chemistry and biochemistry.
Formula:C21H31NO11
InChI:InChI=1/C21H31NO11/c1-10(25)22-14-16(27)19(33-21-18(29)17(28)15(26)12(7-23)31-21)13(8-24)32-20(14)30-9-11-5-3-2-4-6-11/h2-6,12-21,23-24,26-29H,7-9H2,1H3,(H,22,25)/t12?,13?,14-,15-,16+,17-,18-,19+,20+,21-/m0/s1
Synonyms:- PhenylMethyl 2-(AcetylaMino)-2-deoxy-4-O-β-D-galactopyranosyl-β-D-glucopyranoside
- Gal1--4GlcNAc--Bn
- Benzyl 2-Acetamido-2-deoxy-4-O-(-D-galactopyranosyl)--D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 2-acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
CAS:<p>Benzyl 2-acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is an oligosaccharide that is synthesized from D-(+)-galactose, D-(+)-glucose and benzyl alcohol. This product can be used for the modification of saccharides and has been shown to have a high purity. It has been fluorinated at the alpha position and glycosylated with acetamidobenzoyl group. The molecular weight of this product is 378.12 g/mol. CAS No.: 53167-38-7</p>Formula:C21H31NO11Purity:Min. 95%Color and Shape:White PowderMolecular weight:473.47 g/molBenzyl 2-Acetamido-2-deoxy-4-O-(β-D-galactopyranosyl)-β-D-glucopyranoside
CAS:Controlled Product<p>Applications Benzyl 2-Acetamido-2-deoxy-4-O-(β-D-galactopyranosyl)-β-_x000D_D-glucopyranoside (cas# 53167-38-7 ) is a compound useful in organic synthesis.<br>References Ohmae, M., et al.: ChemBioChem., 8, 1710 (2007),<br></p>Formula:C21H31NO11Color and Shape:NeatMolecular weight:473.47


