CAS 53167-38-7: N-[(2R,3S,4R,5S)-2-benzyloxy-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]acetamide
Description:The chemical substance N-[(2R,3S,4R,5S)-2-benzyloxy-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]acetamide, with CAS number 53167-38-7, is a complex organic compound characterized by its multiple hydroxyl groups and sugar-like structures, which suggest it may exhibit significant solubility in polar solvents. The presence of benzyloxy and acetamide functional groups indicates potential for various chemical reactivity, including hydrogen bonding and interactions with biological systems. This compound is likely to be a glycoside or a derivative of a carbohydrate, which may impart specific biological activities, such as enzyme inhibition or modulation of metabolic pathways. Its stereochemistry, indicated by the R and S designations, suggests that it may have specific spatial configurations that could influence its biological interactions and pharmacological properties. Overall, this compound's structural complexity and functional groups make it a candidate for further investigation in medicinal chemistry and biochemistry.
Formula:C21H31NO11
InChI:InChI=1/C21H31NO11/c1-10(25)22-14-16(27)19(33-21-18(29)17(28)15(26)12(7-23)31-21)13(8-24)32-20(14)30-9-11-5-3-2-4-6-11/h2-6,12-21,23-24,26-29H,7-9H2,1H3,(H,22,25)/t12?,13?,14-,15-,16+,17-,18-,19+,20+,21-/m0/s1

Ref: 7W-GC9607
Undefined size | To inquire |

Benzyl 2-acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
Ref: 3D-OB04591
1mg | 147.00 € | ||
2mg | 201.00 € |

Benzyl 2-Acetamido-2-deoxy-4-O-(Beta-D-galactopyranosyl)-Beta-D-glucopyranoside
Controlled ProductRef: TR-B212535
5mg | 266.00 € |