CAS 5317-89-5

N-(4-acetylphenyl)methanesulfonamide

Description:

N-(4-acetylphenyl)methanesulfonamide, with the CAS number 5317-89-5, is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features an acetyl group attached to a phenyl ring, contributing to its aromatic characteristics and potential reactivity. The methanesulfonamide moiety enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry. Typically, sulfonamides exhibit a range of biological activities, including antimicrobial effects, and can serve as intermediates in the synthesis of more complex molecules. The presence of the acetyl group may influence the compound's pharmacokinetics and biological interactions. In terms of physical properties, it is generally a solid at room temperature, with a specific melting point and solubility profile that can vary based on environmental conditions. Overall, N-(4-acetylphenyl)methanesulfonamide is of interest in pharmaceutical research and development due to its potential therapeutic applications.

Formula: C₉H₁₁NO₃S

InChI: InChI=1/C9H11NO3S/c1-7(11)8-3-5-9(6-4-8)10-14(2,12)13/h3-6,10H,1-2H3

SMILES: CC(=O)c1ccc(cc1)NS(=O)(=O)C

Synonyms:

• Methanesulfonamide, N-(4-acetylphenyl)-

N-(4-ACETYL-PHENYL)-METHANESULFON-AMIDE

CAS: 5317-89-5

Formula: C₉H₁₁NO₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 213.2535

Ref: IN-DA00DEJY

N-(4-Acetylphenyl)methanesulfonamide

CAS: 5317-89-5

N-(4-Acetylphenyl)methanesulfonamide

Purity: 98%

Molecular weight: 213.25354g/mol

Ref: 54-OR89912

N-(4-Acetylphenyl)methanesulfonamide

CAS: 5317-89-5

Formula: C₉H₁₁NO₃S

Purity: 98%

Color and Shape: Solid, Beige powder

Molecular weight: 213.25

Ref: 10-F336941