CAS 53174-98-4

thieno[2,3-b]pyridine-2-carbaldehyde

Description:

Thieno[2,3-b]pyridine-2-carbaldehyde is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carbaldehyde functional group, indicating the presence of an aldehyde (-CHO) moiety, which is known for its reactivity in various chemical reactions, including nucleophilic addition and condensation. The thieno and pyridine rings provide a planar structure that can facilitate π-π stacking interactions, making it potentially useful in organic electronics and materials science. Additionally, the presence of nitrogen in the pyridine ring can influence the compound's basicity and reactivity, allowing it to participate in coordination chemistry with metal ions. Thieno[2,3-b]pyridine-2-carbaldehyde may also exhibit biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Its solubility and stability in various solvents can vary, which is important for its application in synthetic processes and research. Overall, this compound represents a versatile building block in organic synthesis and materials development.

Formula: C₈H₅NOS

InChI: InChI=1/C8H5NOS/c10-5-7-4-6-2-1-3-9-8(6)11-7/h1-5H

SMILES: c1cc2cc(C=O)sc2nc1

Thieno[2,3-b]pyridine-2-carbaldehyde

CAS: 53174-98-4

Formula: C₈H₅NOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.1964

Ref: IN-DA00DCP1

Thieno[2,3-b]pyridine-2-carboxaldehyde

CAS: 53174-98-4

Thieno[2,3-b]pyridine-2-carboxaldehyde

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.20g/mol

Ref: 54-OR6738

Thieno[2,3-b]pyridine-2-carbaldehyde

CAS: 53174-98-4

Formula: C₈H₅NOS

Purity: 98%

Molecular weight: 163.19

Ref: 10-F317767

Thieno[2,3-b]pyridine-2-carbaldehyde

CAS: 53174-98-4

Thieno[2,3-b]pyridine-2-carbaldehyde is a chemical compound that is structurally related to nicotine. It has been shown to be an inhibitor of CYP2A6 and coumarin 7-hydroxylase, the enzymes that catalyze the hydroxylation of coumarin to form 7-hydroxycoumarin. Thieno[2,3-b]pyridine-2-carbaldehyde has also shown inhibitory effects on the metabolism of formyl lead molecules. The IC50 values for thieno[2,3-b]pyridine-2-carbaldehyde are 0.01 μM for CYP2A6 and 0.1 μM for coumarin 7-hydroxylase.

Formula: C₈H₅NOS

Purity: Min. 95%

Molecular weight: 163.2 g/mol

Ref: 3D-DCA17498