CAS 53177-12-1

manganese(3+) chloride 2,2'-{ethane-1,2-diylbis[nitrilo(E)methylylidene]}diphenolate (1:1:1)

Description:

Manganese(3+) chloride 2,2'-{ethane-1,2-diylbis[nitrilo(E)methylylidene]}diphenolate, with the CAS number 53177-12-1, is a coordination compound featuring manganese in a +3 oxidation state. This compound typically exhibits a complex structure due to the presence of a bidentate ligand that coordinates with the manganese ion, enhancing its stability and solubility in various solvents. The diphenolate moiety contributes to the compound's chelating properties, allowing it to form stable complexes with metal ions. Manganese(3+) is known for its redox activity, making this compound potentially useful in catalysis and as a precursor in various chemical reactions. The presence of the ethane-1,2-diylbis(nitrilo(E)methylylidene) ligand suggests that the compound may exhibit interesting electronic and steric properties, which could influence its reactivity and interaction with other chemical species. Overall, this compound represents a unique example of manganese coordination chemistry, with potential applications in materials science and catalysis.

Formula: C₁₆H₁₄ClMnN₂O₂

InChI: InChI=1/C16H16N2O2.ClH.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;1H;/q;;+3/p-3/b17-11+,18-12+;;

SMILES: c1ccc(c(c1)C=NCCN=Cc1ccccc1O)O.Cl.[Mn]

N,N'-bis(salicylideneamino)ethane-manganese(II)

CAS: 53177-12-1

Formula: C₁₆H₁₄ClMnN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 356.6856

Ref: IN-DA00DBVU

N,N’-Bis(Salicylideneamino)Ethane-Manganese(II)

CAS: 53177-12-1

N,N’-Bis(Salicylideneamino)Ethane-Manganese(II)

Purity: 95%

Molecular weight: 356.69g/mol

Ref: 54-IN10551

Manganese(salen) chloride

CAS: 53177-12-1

Manganese(salen) chloride

Purity: ≥98%

Molecular weight: 356.69g/mol

Ref: 54-BUP13768

Manganese(salen) chloride

CAS: 53177-12-1

Manganese(salen) chloride (EUK-8) mimics SOD/catalase, is an antioxidant, and lessens acute lung injury in swine.

Formula: C₁₆H₁₄ClMnN₂O₂

Purity: 99.52%

Color and Shape: Solid

Molecular weight: 356.69

Ref: TM-T40612

[N,N 0-Disalicylidene-1,2-ethanediaminato-(2-)]manganese(III) Chloride

Controlled Product

CAS: 53177-12-1

Applications [N,N 0-Disalicylidene-1,2-ethanediaminato-(2-)]manganese(III) Chloride (cas# 53177-12-1) is a useful research chemical.

Formula: C₁₆H₁₄N₂O₂·Cl·Mn

Color and Shape: Neat

Molecular weight: 356.686

Ref: TR-D493573

EUK-8

CAS: 53177-12-1

EUK-8 is a synthetic antioxidant that inhibits oxidative injury. It is synthesized by the condensation of two molecules of 2-(2,6-dimethoxybenzyl)phenol with one molecule of ethylene diamine. The molecular weight of EUK-8 is 720 g/mol and its chemical formula is C12H18N4O4. EUK-8 has been shown to inhibit lipid peroxidation induced by superoxide generated from xanthine oxidase in rat liver mitochondria. EUK-8 also has antioxidant properties and can be used to treat oxidative injury in experimental models such as those involving mitochondrial membrane potential or basic protein redox potentials.
EUK-8 has been shown to protect against experimental models of oxidative stress such as Parkinson’s disease, stroke, Alzheimer's disease, and liver cirrhosis.

Formula: C₁₆H₁₄ClMnN₂O₂

Purity: Min. 95%

Molecular weight: 356.69 g/mol

Ref: 3D-DCA17712