CAS 5318-27-4
:6-Aminoindole
Description:
6-Aminoindole is an organic compound characterized by the presence of an amino group (-NH2) attached to the indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The amino group enhances its reactivity, allowing for further chemical modifications. 6-Aminoindole is soluble in polar solvents, and its properties can vary based on the pH of the solution due to the ionization of the amino group. It can participate in various chemical reactions, including electrophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, its structural features contribute to its biological activity, which has been explored in research related to neurochemistry and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C18H20ClN3O2
InChI:InChI=1/C18H20ClN3O2/c1-3-22(4-2)16-9-8-14(17(23)11-16)12-20-21-18(24)13-6-5-7-15(19)10-13/h5-12,20H,3-4H2,1-2H3,(H,21,24)/b14-12+
Synonyms:- 6-Indolamine
- 1H-indol-6-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Aminoindole
CAS:Formula:C8H8N2Purity:>98.0%(GC)(T)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:132.176-Amino-1H-indole
CAS:6-Amino-1H-indoleFormula:C8H8N2Purity:≥95%Color and Shape: black solidMolecular weight:132.16g/mol6-Aminoindole
CAS:<p>6-Aminoindole is a model complex that can be used for studying the interactions of primary amines with acidic molecules in bioinorganic chemistry. The molecule was synthesized by electropolymerization, which involves the oxidation of aniline with bifunctional oxidases. 6-Aminoindole has been shown to have protonation and salicylaldehyde properties. It reacts with metal surfaces to form a molecular target.</p>Formula:C8H8N2Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:132.16 g/mol6-Amino-1H-indole
CAS:Formula:C8H8N2Purity:98%Color and Shape:Solid, Off-white to light brown crystalline powderMolecular weight:132.1666-Aminoindole
CAS:6-Aminoindole is a chemical compound that can be used as an intermediate in the synthesis of other chemicals. It is also a useful scaffold for the production of complex compounds and can be used as a research chemical, reaction component, or specialty chemical. 6-Aminoindole has been shown to have high purity and quality, which makes it an excellent reagent for use in laboratories.Formula:C8H8N2Purity:Min. 98.0 Area-%Molecular weight:132.16 g/mol




