CAS 532-48-9
:Euparin
Description:
Euparin, with the CAS number 532-48-9, is a chemical compound that belongs to the class of anticoagulants, specifically a type of heparin. It is primarily used for its anticoagulant properties, which help prevent blood clot formation. Euparin is characterized by its ability to enhance the activity of antithrombin III, leading to the inhibition of thrombin and factor Xa, crucial components in the coagulation cascade. This action makes it valuable in medical applications, particularly in the prevention and treatment of thromboembolic disorders. The compound is typically administered via injection due to its poor oral bioavailability. In terms of physical properties, Euparin is a white to off-white powder that is soluble in water, which facilitates its use in various formulations. Safety and efficacy are paramount in its application, and it is essential to monitor patients for potential side effects, such as bleeding complications. Overall, Euparin plays a significant role in modern medicine, particularly in managing conditions related to blood clotting.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-7(2)12-5-9-4-10(8(3)14)11(15)6-13(9)16-12/h4-6,15H,1H2,2-3H3
InChI key:InChIKey=OPUFDNZTKHPZHM-UHFFFAOYSA-N
SMILES:C(C)(=C)C=1OC=2C(=CC(C(C)=O)=C(O)C2)C1
Synonyms:- 1-(6-Hydroxy-2-(1-methylethenyl)-5-benzofuranyl)ethanone
- 1-[6-Hydroxy-2-(prop-1-en-2-yl)-1-benzofuran-5-yl]ethan-1-one
- 5-Acetyl-6-hydroxy-2-isopropenylbenzofuran
- 6-Hydroxy-2-isopropenyl-5-benzofuranyl Methyl Ketone
- Ethanone, 1-(6-hydroxy-2-(1-methylethenyl)-5-benzofuranyl)-
- Euparin
- Euparine
- Ketone, 6-hydroxy-2-isopropenyl-5-benzofuranyl methyl
- Methyl(2-isopropenyl-6-hydroxybenzofuran-5-yl) ketone
- 1-(6-hydroxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone
- EUPARIN(P)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA00DGQI
5mg321.00€20mg616.00€25mgTo inquire50mgTo inquire100mgTo inquire200mgTo inquire500mgTo inquireEuparin
CAS:Euparin is a naturally derived compound, which is a type of bibenzyl, sourced from various species of the Eupatorium plant. Eupatorium is a genus of flowering plants in the family Asteraceae, often known for their medicinal properties. The mode of action of Euparin involves its ability to disrupt microbial cell membranes, effectively hindering the growth and proliferation of various bacteria and fungi. This compound interferes with essential cellular processes, leading to microbial cell death.Formula:C13H12O3Purity:Min. 95%Molecular weight:216.23 g/molEuparin
CAS:Euparin exhibits a moderate antioxidant activity, it also exhibits antifungal activity against Trichophyton mentagrophytes. Euparin has antiviral activity, it exerts its effect during the early events of the replication cycle, from the virus adsorption toFormula:C13H12O3Purity:98%Color and Shape:SolidMolecular weight:216.23



