CAS 5323-65-9
:2-chloro-4-(2-methylbutan-2-yl)phenol
Description:
2-Chloro-4-(2-methylbutan-2-yl)phenol, with the CAS number 5323-65-9, is an organic compound characterized by its phenolic structure, which includes a chlorine atom and a branched alkyl group. This compound features a chlorine substituent at the para position relative to the hydroxyl group on the aromatic ring, contributing to its chemical reactivity and potential applications. The presence of the 2-methylbutan-2-yl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature exhibit antimicrobial properties, making them useful in various industrial applications, including as preservatives or disinfectants. Additionally, the chlorinated phenolic compounds can be involved in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Safety considerations are essential when handling this compound, as chlorinated phenols can be toxic and may pose environmental hazards. Overall, 2-chloro-4-(2-methylbutan-2-yl)phenol is a notable compound in organic chemistry with specific functional properties and applications.
Formula:C11H15ClO
InChI:InChI=1/C11H15ClO/c1-4-11(2,3)8-5-6-10(13)9(12)7-8/h5-7,13H,4H2,1-3H3
SMILES:CCC(C)(C)c1ccc(c(c1)Cl)O
Synonyms:- Chloro-4-tert-amylphenol
- Phenol, 2-chloro-4-(1,1-dimethylpropyl)-
- Phenol, 2-chloro-4-tert-pentyl-
- Phenol, chloro-4-(1,1-dimethylpropyl)-
- 2-Chloro-4-(tert-pentyl)-phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-(2-methylbutan-2-yl)phenol
CAS:Formula:C11H15ClOPurity:95%Color and Shape:LiquidMolecular weight:198.68922-Chloro-4-(tert-pentyl)phenol
CAS:2-Chloro-4-(tert-pentyl)phenolPurity:99%Molecular weight:198.693g/mol2-Chloro-4-(tert-pentyl)phenol
CAS:Controlled Product<p>Applications 2-Chloro-4-(tert-pentyl)phenol (cas# 5323-65-9) is a useful research chemical.<br></p>Formula:C11H15OClColor and Shape:YellowMolecular weight:198.682-Chloro-4-(tert-pentyl)phenol
CAS:Formula:C11H15ClOPurity:95%Color and Shape:LiquidMolecular weight:198.692-Chloro-4-(tert-pentyl)phenol
CAS:<p>2-Chloro-4-(tert-pentyl)phenol is an aromatic compound. It has a cyclic, unsaturated alkyl group with a biphenyl and 6-membered heterocycle. This compound also has a haloalkyl group that can be substituted by nitro or benzoxazine groups. 2-Chloro-4-(tert-pentyl)phenol is used as an intermediate in the production of pharmaceuticals, dyes, and pesticides.</p>Formula:C11H15ClOPurity:Min. 95%Molecular weight:198.69 g/mol




