CAS 53234-55-2
:5-Cyanopicolinic acid
Description:
5-Cyanopicolinic acid, with the CAS number 53234-55-2, is an organic compound that belongs to the class of pyridinecarboxylic acids. It features a pyridine ring substituted with a cyano group and a carboxylic acid group, which contributes to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. 5-Cyanopicolinic acid is known for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of various bioactive molecules. Its unique structure allows for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological activities can vary based on the context of use. As with many chemical substances, handling should be done with care, following appropriate safety guidelines to mitigate any potential hazards.
Formula:C7H4N2O2
InChI:InChI=1S/C7H4N2O2/c8-3-5-1-2-6(7(10)11)9-4-5/h1-2,4H,(H,10,11)
InChI key:InChIKey=HRLVPHGCEGTVLK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C#N)C=N1
Synonyms:- 2-Pyridinecarboxylic acid, 5-cyano-
- 5-Cyano-2-pyridinecarboxylic acid
- 5-Cyano-2-pyridinecarboxylicacid
- 5-Cyanopicolinic acid
- 5-Cyanopicoliniic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Cyanopyridine-2-carboxylic acid, 95%
CAS:<p>It is used as pharmaceutical intermediate. Benzoylthiophenes are allosteric enhancers (AE) of agonist activity at the A1 adenosine receptor. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to t</p>Formula:C7H4N2O2Purity:95%Color and Shape:Powder, White to pale creamMolecular weight:148.125-Cyanopicolinic Acid
CAS:Formula:C7H4N2O2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:148.125-Cyanopyridine-2-carboxylic acid
CAS:5-Cyanopyridine-2-carboxylic acidFormula:C7H4N2O2Purity:98%Color and Shape:SolidMolecular weight:148.11886g/mol5-Cyano-2-pyridinecarboxylic acid
CAS:Formula:C7H4N2O2Purity:97%Color and Shape:SolidMolecular weight:148.1215-Cyanopyridine-2-carboxylic acid
CAS:<p>5-Cyanopyridine-2-carboxylic acid is a small molecule that has been found to have significant biological activity in a number of different areas, including neurotherapeutics. It is the result of a scalable synthesis and is soluble in water. The molecule has two chiral centers and can exist as four different stereoisomers (enantiomers). In vitro studies show that 5-cyanopyridine-2-carboxylic acid inhibits fatty acid uptake by blocking the proton pump, which transports lipids into cells. This compound also binds to the cytosolic protein pyrazine 2-carboxylic acid receptor 1 (PYZR1), which may provide an explanation for its effects on fatty acid uptake.</p>Formula:C7H4N2O2Purity:Min. 95%Molecular weight:148.12 g/mol




