CAS 53242-18-5

5-Amino-3-bromo-2-methoxypyridine

Description:

5-Amino-3-bromo-2-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 5-position and a bromo substituent at the 3-position, along with a methoxy group (-OCH3) at the 2-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and methoxy groups, which can engage in hydrogen bonding. The bromine atom introduces a halogen, which can influence the reactivity of the compound, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the amino group may impart basic characteristics, allowing it to participate in acid-base reactions. This compound is of interest in medicinal chemistry and materials science, where its derivatives may exhibit biological activity or serve as intermediates in the synthesis of more complex molecules.

Formula: C₆H₇BrN₂O

InChI: InChI=1/C6H7BrN2O/c1-10-6-5(7)2-4(8)3-9-6/h2-3H,8H2,1H3

SMILES: COc1c(cc(cn1)N)Br

Synonyms:

• 3-Pyridinamine, 5-bromo-6-methoxy-
• 5-Bromo-6-methoxypyridin-3-amine

5-AMino-3-broMo-2-Methoxypyridine

CAS: 53242-18-5

Formula: C₆H₇BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 203.0366

Ref: IN-DA00D8S7

5-Amino-3-bromo-2-methoxypyridine

CAS: 53242-18-5

5-Amino-3-bromo-2-methoxypyridine

Formula: C₆H₇BrN₂O

Purity: 98%

Color and Shape: Light Yellow Solid

Molecular weight: 203.04g/mol

Ref: 54-OR8426

5-Amino-3-bromo-2-methoxypyridine

CAS: 53242-18-5

Formula: C₆H₇BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.039

Ref: 10-F036163

5-Amino-3-bromo-2-methoxypyridine

CAS: 53242-18-5

Formula: C₆H₇BrN₂O

Molecular weight: 203.04

Ref: ST-EA-CP-B29019