CAS 53243-58-6

[bis(benzyloxy)phosphoryl]acetate

Description:

Bis(benzyloxy)phosphoryl acetate is a chemical compound characterized by its unique structure, which includes a phosphoryl group bonded to two benzyloxy groups and an acetate moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water due to its hydrophobic benzyloxy groups. The presence of the phosphoryl group suggests potential reactivity, particularly in nucleophilic substitution reactions, making it of interest in organic synthesis and possibly in the development of phosphorous-containing compounds. Additionally, the benzyloxy groups can provide stability and enhance the lipophilicity of the molecule, which may influence its biological activity and interactions. Safety precautions should be taken when handling this compound, as it may pose health risks similar to other organophosphorus compounds. Overall, bis(benzyloxy)phosphoryl acetate is a versatile compound with applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₆H₁₆O₅P

InChI: InChI=1/C16H17O5P/c17-16(18)13-22(19,20-11-14-7-3-1-4-8-14)21-12-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,17,18)/p-1

SMILES: c1ccc(cc1)COP(=O)(CC(=O)[O-])OCc1ccccc1

2-Dibenzyloxyphosphanylacetic Acid

Controlled Product

CAS: 53243-58-6

Applications 2-Dibenzyloxyphosphanylacetic acid (cas# 53243-58-6) is a useful research chemical.

Formula: C₁₆H₁₇O₅P

Color and Shape: Neat

Molecular weight: 320.28

Ref: TR-D533933