CAS 53250-84-3: 4-(Aminosulfonyl)-2-chlorobenzoic acid
Description:4-(Aminosulfonyl)-2-chlorobenzoic acid, also known by its CAS number 53250-84-3, is a chemical compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an amino group and a sulfonyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid and sulfonamide functional groups. The amino group contributes to its basicity, while the sulfonyl group enhances its reactivity and potential for forming hydrogen bonds. It is often utilized in pharmaceutical research and development, particularly in the synthesis of biologically active compounds. The presence of the chlorine atom introduces additional reactivity and can influence the compound's biological activity. Overall, 4-(Aminosulfonyl)-2-chlorobenzoic acid is significant in medicinal chemistry, particularly in the design of drugs targeting various biological pathways.
Formula:C7H6ClNO4S
InChI:InChI=1S/C7H6ClNO4S/c8-6-3-4(14(9,12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11)(H2,9,12,13)
InChI key:InChIKey=RUOXWQNWRLQUBE-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C=C1Cl)S(=O)(=O)N
- Synonyms:
- 2-Chloro-4-sulfamoylbenzoic acid
- 4-(Aminosulfonyl)-2-chlorobenzoic acid
- Benzoic acid, 4-(aminosulfonyl)-2-chloro-
- Benzoic acid, 2-chloro-4-sulfamoyl-
- 4-Sulphamoyl-2-chlorobenzoic acid
- 2-Thiazolamine,5-bromo-,hydrobromide(1:2)

2-Chloro-4-sulfamoylbenzoic acid
Ref: IN-DA01AE07
25mg | 237.00 € |

Ref: 4Z-T-799
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

2-Chloro-4-sulfamoylbenzoic acid
Ref: 3D-DCA25084
50mg | 499.00 € | ||
500mg | 1,365.00 € |

Ref: ST-EA-CP-T267008
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |