CymitQuimica logo

CAS 53255-89-3

:

octyl 2-(trimethylammonio)ethyl phosphate

Description:
Octyl 2-(trimethylammonio)ethyl phosphate, with the CAS number 53255-89-3, is a quaternary ammonium compound that exhibits surfactant properties. It is characterized by a long hydrophobic octyl chain, which contributes to its ability to interact with lipid membranes and enhance solubility in non-polar environments. The presence of the trimethylammonio group imparts a positive charge, making it cationic in nature, which can facilitate interactions with negatively charged surfaces or molecules. This compound is often utilized in various applications, including as a surfactant in formulations, in drug delivery systems, and in biochemical research due to its ability to form micelles and stabilize emulsions. Its amphiphilic nature allows it to reduce surface tension and improve wetting properties, making it valuable in both industrial and laboratory settings. Additionally, octyl 2-(trimethylammonio)ethyl phosphate may exhibit antimicrobial properties, which can be advantageous in certain applications. However, safety and environmental considerations should be taken into account when handling and using this compound.
Formula:C13H30NO4P
InChI:InChI=1/C13H30NO4P/c1-5-6-7-8-9-10-12-17-19(15,16)18-13-11-14(2,3)4/h5-13H2,1-4H3
SMILES:CCCCCCCCOP(=O)([O-])OCC[N+](C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.