CAS 5326-23-8
:6-Chloronicotinic acid
Description:
6-Chloronicotinic acid, with the CAS number 5326-23-8, is a heterocyclic organic compound that belongs to the class of chlorinated pyridine derivatives. It features a pyridine ring substituted with a carboxylic acid group and a chlorine atom at the 6-position. This compound is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. 6-Chloronicotinic acid is of interest in medicinal chemistry and agricultural chemistry due to its potential as a building block for the synthesis of pharmaceuticals and agrochemicals. Its structural characteristics allow for various functionalizations, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit biological activity, including antimicrobial and anti-inflammatory properties, although specific biological effects can vary based on the context of its use. Proper handling and storage are essential due to its chemical reactivity and potential environmental impact.
Formula:C6H4ClNO2
InChI:InChI=1S/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10)
InChI key:InChIKey=UAWMVMPAYRWUFX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CC(Cl)=NC1
Synonyms:- 2-Chloro-5-pyridinecarboxylic acid
- 3-Carboxy-6-chloropyridine
- 3-Pyridinecarboxylic acid, 6-chloro-
- 6-Chloro-3-pyridinecarboxylic acid
- 6-Chloro-Nicotinic Acid
- 6-Chloropyridin-3-carboxylic acid
- 6-Chloropyridine-3-Carboxylate
- 6-Chloropyridine-3-carboxylic acid
- NSC 277
- Nicotinic acid, 6-chloro-
- Rarechem Al Bo 0729
- Timtec-Bb Sbb004004
- 6-Chloronicotinic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-Chloronicotinic Acid
CAS:Formula:C6H4ClNO2Purity:>98.0%(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:157.556-Chloronicotinic acid, 99%
CAS:6-Chloropyridine-3-carboxylic acid (6-chloronicotinic acid/6-CNA) has been used to study its photolytic and photocatalytic degradation. The product has been used as a media component during the isolation of 6-CNA degrading bacterial strain from imidacloprid-exposed soil samples. This Thermo ScientifFormula:C6H4ClNO2Purity:99%Color and Shape:Pale cream to cream to pale brown, PowderMolecular weight:157.55Ref: IN-DA003N6T
5gTo inquire10g21.00€25g25.00€50g25.00€100g37.00€250g68.00€500g107.00€1kg166.00€10kg1,029.00€25kg2,197.00€6-Chloronicotinic acid
CAS:6-Chloronicotinic acidFormula:C6H4ClNO2Purity:98%Color and Shape:Solid-PowderMolecular weight:157.554466-Chloronicotinic acid
CAS:Formula:C6H4ClNO2Purity:(HPLC) ≥ 98.5%Color and Shape:Off-white to beige crystalline powderMolecular weight:157.566-Chloronicotinic Acid
CAS:Controlled ProductApplications 6-Chloronicotinic Acid, is an organic building block used for the synthesis of various biologically active compounds, including inhibitors. It is an intermediate for the synthesis of N-(thiophen-2-yl) benzamide derivatives as BRAFV600E inhibitors, and novel DNA-gyrase B inhibitors.
References Xie, Y., et al.: Bioorg. Med. Chem. Lett., 23, 2306 (2013); Shiroya, U., et al.: Med. Chem. Res., 22, 5227 (2013);Formula:C6H4ClNO2Color and Shape:NeatMolecular weight:157.556-Chloronicotinic acid
CAS:Formula:C6H4ClNO2Purity:96%Color and Shape:Solid, Crystalline PowderMolecular weight:157.55







