CAS 5327-00-4

2-bromo-N-ethylacetamide

Description:

2-Bromo-N-ethylacetamide is an organic compound characterized by its structure, which includes a bromine atom, an ethyl group, and an acetamide functional group. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the formation of carbon-carbon bonds and as a building block in pharmaceuticals and agrochemicals. The compound is soluble in organic solvents, and its polar acetamide group enhances its interaction with other polar substances. As with many halogenated compounds, it may exhibit biological activity, and safety precautions should be taken when handling it due to potential toxicity and environmental concerns. Proper storage conditions are essential to maintain its stability, and it should be kept away from strong oxidizing agents. Overall, 2-bromo-N-ethylacetamide serves as a versatile intermediate in organic synthesis and research.

Formula: C₄H₈BrNO

InChI: InChI=1/C4H8BrNO/c1-2-6-4(7)3-5/h2-3H2,1H3,(H,6,7)

SMILES: CCN=C(CBr)O

Synonyms:

• acetamide, 2-bromo-N-ethyl-
• 2-Bromo-N-ethylacetamide

2-Bromo-N-ethylacetamide

CAS: 5327-00-4

2-Bromo-N-ethylacetamide

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 166.02g/mol

Ref: 54-OR40485

2-bromo-N-ethylacetamide

CAS: 5327-00-4

Formula: C₄H₈BrNO

Purity: 95+%

Color and Shape: Solid

Molecular weight: 166.018

Ref: 10-F310086