CAS 5328-64-3
:D-glycero-D-galacto-heptose
Description:
D-glycero-D-galacto-heptose is a seven-carbon sugar, specifically a heptose, that plays a significant role in the structure of certain bacterial lipopolysaccharides. It is characterized by its unique configuration, which includes two stereogenic centers, resulting in a specific three-dimensional arrangement that is crucial for its biological function. This sugar is typically found in the outer membrane of Gram-negative bacteria, contributing to the structural integrity and protective barrier of the cell wall. D-glycero-D-galacto-heptose is involved in various biochemical processes, including cell signaling and immune response modulation. Its presence can influence the virulence of pathogenic bacteria, making it a subject of interest in microbiology and immunology. The compound is soluble in water, and its reactivity can be influenced by the presence of functional groups, allowing for potential modifications in synthetic chemistry. Overall, D-glycero-D-galacto-heptose is an important carbohydrate with implications in both fundamental research and applied sciences, particularly in the development of vaccines and antimicrobial agents.
Formula:C7H14O7
InChI:InChI=1/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2/t3-,4+,5+,6+,7+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-glycero-D-galacto-Heptose
CAS:D-Glycero-D-galacto-heptose is a sugar that has been shown to have antimicrobial properties and inhibit the growth of oral pathogens. It inhibits the enzyme glycosyltransferase, which is responsible for synthesizing D-galactosyl sugars. This inhibition prevents the formation of a substrate for the enzyme β-1,4-N acetylglucosaminyltransferase, which is necessary for bacterial cell wall synthesis. This leads to cell death as a result of impaired membrane integrity. D-Glycero-D-galacto-heptose has been shown to have inhibitory properties against both Gram negative and Gram positive bacteria in vitro assays. The mechanism of action is through target enzymes such as glycosyltransferases, which are necessary for bacterial cell wall synthesis. Inhibition of these enzymes leads to cell death by impairing membrane integrity.Formula:C7H14O7Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:210.18 g/mol
