CAS 5328-76-7
:1-Bromo-5-nitronaphthalene
Description:
1-Bromo-5-nitronaphthalene is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a naphthalene ring system. It features a bromine atom at the 1-position and a nitro group at the 5-position of the naphthalene structure, which contributes to its reactivity and potential applications in organic synthesis. This compound is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of the bromine atom makes it a suitable candidate for nucleophilic substitution reactions, while the nitro group can participate in electrophilic aromatic substitution. 1-Bromo-5-nitronaphthalene is often used as an intermediate in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage in a cool, dry place away from incompatible materials is also recommended.
Formula:C10H6BrNO2
InChI:InChI=1/C10H6BrNO2/c11-9-5-1-4-8-7(9)3-2-6-10(8)12(13)14/h1-6H
SMILES:c1cc2c(cccc2N(=O)=O)c(c1)Br
Synonyms:- 5-Bromo-1-Nitro-Naphthalene
- 5-Bromo-1-nitronaphthalene
- Naphthalene, 1-Bromo-5-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-5-nitronaphthalene
CAS:Formula:C10H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:252.0675-bromo-1-nitro-naphthalene
CAS:Formula:C10H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:252.06411-Bromo-5-nitronaphthalene
CAS:1-Bromo-5-nitronaphthaleneFormula:C10H6BrNO2Purity:96%Color and Shape: light brown to brown powderMolecular weight:252.06g/mol1-Bromo-5-nitronaphthalene
CAS:<p>1-Bromo-5-nitronaphthalene is a molecule that consists of two benzene rings and one nitro group. It has three conformers, which are analyzed and stabilized by the solute dioxane. The orientation of the molecule varies depending on the solvent it is in, as shown by constants. In addition to the dipole interactions between hydrogen atoms and oxygen atoms, 1-Bromo-5-nitronaphthalene also interacts with naphthalene.</p>Formula:C10H6BrNO2Purity:Min. 95%Molecular weight:252.06 g/mol



