CAS 53287-33-5

3-hydroxy-4-(methylsulfonyl)tetrahydro-1H-1lambda~6~-thiophene-1,1-dione

Description:

3-Hydroxy-4-(methylsulfonyl)tetrahydro-1H-1λ^6-thiophene-1,1-dione, with the CAS number 53287-33-5, is a chemical compound characterized by its unique structure that includes a thiophene ring, which is a five-membered aromatic ring containing sulfur. This compound features a hydroxyl group (-OH) and a methylsulfonyl group (-SO2CH3) that contribute to its chemical reactivity and solubility properties. The presence of the thiophene ring and the dione functional groups indicates potential applications in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, making it of interest for pharmaceutical research. Its solubility in various solvents can vary, influenced by the functional groups present. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 3-hydroxy-4-(methylsulfonyl)tetrahydro-1H-1λ^6-thiophene-1,1-dione represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₅H₁₀O₅S₂

InChI: InChI=1/C5H10O5S2/c1-11(7,8)5-3-12(9,10)2-4(5)6/h4-6H,2-3H2,1H3

SMILES: CS(=O)(=O)C1CS(=O)(=O)CC1O

Synonyms:

• 4-(Methylsulfonyl)Tetrahydrothiophene-3-Ol 1,1-Dioxide

3-Hydroxy-4-(methylsulphonyl)thiolane 1,1-dioxide

CAS: 53287-33-5

3-Hydroxy-4-(methylsulphonyl)thiolane 1,1-dioxide

Purity: ≥95%

Molecular weight: 214.26g/mol

Ref: 54-OR0534