CAS 5329-43-1

3-Hydroxy-2,4(1H,3H)-quinazolinedione

Description:

3-Hydroxy-2,4(1H,3H)-quinazolinedione, also known as 3-hydroxyquinazoline-2,4-dione, is a heterocyclic organic compound characterized by its quinazoline core structure, which features a fused benzene and pyrimidine ring. This compound typically exhibits a pale yellow to brownish color and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the hydroxyl group at the 3-position and the dione functionality at the 2 and 4 positions contribute to its reactivity and solubility in various solvents. It is often utilized in medicinal chemistry and research due to its ability to interact with biological targets. The compound's molecular structure allows for various substitutions, which can influence its pharmacological properties. As with many quinazoline derivatives, it may also serve as a scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₈H₆N₂O₃

InChI: InChI=1S/C8H6N2O3/c11-7-5-3-1-2-4-6(5)9-8(12)10(7)13/h1-4,13H,(H,9,12)

InChI key: InChIKey=TZZSQUATPYDROZ-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(=O)N1O)=CC=CC2

Synonyms:

• 3-Hydroxy-2,4(1H,3H)-quinazolinedione
• NSC 2552
• 3-Hydroxyquinazoline-2,4(1H,3H)-dione
• 2,4(1H,3H)-Quinazolinedione, 3-hydroxy-

3-Hydroxy-1,2,3,4-tetrahydroquinazoline-2,4-dione

CAS: 5329-43-1

3-Hydroxy-1,2,3,4-tetrahydroquinazoline-2,4-dione is an amido-containing amino acid that is a potent and selective antagonist of the AMPA receptor. It has been shown to be active against influenza A and B viruses in cell culture. 3-Hydroxy-1,2,3,4-tetrahydroquinazoline-2,4-dione also inhibits glutamate release in the brain by blocking presynaptic calcium currents. The molecular modeling study of this drug on a chlorine atom revealed a hydrogen bond with the carboxyl group at position 2 and a nitrogen atom at position 4. This hydrogen bond may explain its pharmacokinetic properties.

Formula: C₈H₆N₂O₃

Purity: Min. 95%

Molecular weight: 178.14 g/mol

Ref: 3D-FAA32943