CAS 5329-50-0
:(2R,4S,5R)-2-benzyloxytetrahydropyran-3,4,5-triol
Description:
The chemical substance known as (2R,4S,5R)-2-benzyloxytetrahydropyran-3,4,5-triol, with the CAS number 5329-50-0, is a carbohydrate derivative characterized by its tetrahydropyran ring structure. This compound features multiple hydroxyl (-OH) groups, which contribute to its hydrophilicity and reactivity, making it soluble in polar solvents like water. The presence of a benzyloxy group enhances its stability and can influence its biological activity. The specific stereochemistry, indicated by the R and S configurations, plays a crucial role in determining the compound's interactions with biological systems, including enzyme recognition and binding affinity. As a sugar alcohol derivative, it may exhibit properties such as sweetness and potential applications in pharmaceuticals or as a food additive. Its structural features suggest it could participate in various chemical reactions, including oxidation and glycosylation, making it a valuable compound in organic synthesis and medicinal chemistry. Overall, this compound's unique characteristics stem from its functional groups and stereochemistry, which dictate its chemical behavior and potential applications.
Formula:C12H16O5
InChI:InChI=1/C12H16O5/c13-9-7-17-12(11(15)10(9)14)16-6-8-4-2-1-3-5-8/h1-5,9-15H,6-7H2/t9-,10+,11?,12-/m1/s1
Synonyms:- (2R,3S,4R,5R)-2-(Benzyloxy)Tetrahydro-2H-Pyran-3,4,5-Triol
- Benzylb-L-arabinopyranoside
- β-D-Arabinopyranoside, phenylmethyl
- (2R,3S,4R,5R)-2-phenylmethoxyoxane-3,4,5-triol
- (2R,3S,4R,5R)-2-benzyloxytetrahydropyran-3,4,5-triol
- Nsc2561
- Benzyl pentopyranoside
- (2R,3S,4R,5R)-2-(Benzyloxy)Tetrahydro-2H-Pyran-3,4,5-Triol(WXC04258)
- Benzyl beta-D-arabinopyranoside, Min. 98%
- Benzyl β-D-Arabinopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzyl β-l-arabinopyranoside
CAS:Formula:C12H16O5Purity:97%Color and Shape:SolidMolecular weight:240.2524(2R,3S,4R,5R)-2-(BENZYLOXY)TETRAHYDRO-2H-PYRAN-3,4,5-TRIOL
CAS:Formula:C12H16O5Purity:97%Molecular weight:240.255Benzyl β-D-Arabinopyranoside
CAS:Controlled ProductFormula:C12H16O5Color and Shape:NeatMolecular weight:240.25Benzyl b-D-arabinopyranoside
CAS:Benzyl b-D-arabinopyranoside is a custom synthesis that can be used in the modification of complex carbohydrates, oligosaccharides, and polysaccharides. This product is a synthetic carbohydrate that can be fluorinated for use as a pharmaceutical or biological agent. It has CAS number 5329-50-0, and can be glycosylated, methylated, or click modified for different applications.
Formula:C12H16O5Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:240.25 g/mol





