CAS 5329-50-0: (2R,4S,5R)-2-benzyloxytetrahydropyran-3,4,5-triol
Description:The chemical substance known as (2R,4S,5R)-2-benzyloxytetrahydropyran-3,4,5-triol, with the CAS number 5329-50-0, is a carbohydrate derivative characterized by its tetrahydropyran ring structure. This compound features multiple hydroxyl (-OH) groups, which contribute to its hydrophilicity and reactivity, making it soluble in polar solvents like water. The presence of a benzyloxy group enhances its stability and can influence its biological activity. The specific stereochemistry, indicated by the R and S configurations, plays a crucial role in determining the compound's interactions with biological systems, including enzyme recognition and binding affinity. As a sugar alcohol derivative, it may exhibit properties such as sweetness and potential applications in pharmaceuticals or as a food additive. Its structural features suggest it could participate in various chemical reactions, including oxidation and glycosylation, making it a valuable compound in organic synthesis and medicinal chemistry. Overall, this compound's unique characteristics stem from its functional groups and stereochemistry, which dictate its chemical behavior and potential applications.
Formula:C12H16O5
InChI:InChI=1/C12H16O5/c13-9-7-17-12(11(15)10(9)14)16-6-8-4-2-1-3-5-8/h1-5,9-15H,6-7H2/t9-,10+,11?,12-/m1/s1
