CAS 532951-91-0

1-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propan-2-one

Description:

1-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propan-2-one is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety substituted with a nitro group and a thioether linkage. This compound features a propan-2-one functional group, indicating the presence of a ketone. The nitro group contributes to its potential reactivity and biological activity, while the benzothiazole ring system is known for its applications in pharmaceuticals and agrochemicals due to its diverse biological properties. The thioether linkage enhances the compound's stability and solubility in various solvents. Additionally, the presence of the nitro group may impart specific electronic properties, influencing the compound's reactivity and interactions with biological targets. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed, as compounds containing nitro groups can pose health risks.

Formula: C₁₀H₈N₂O₃S₂

InChI: InChI=1/C10H8N2O3S2/c1-6(13)5-16-10-11-8-3-2-7(12(14)15)4-9(8)17-10/h2-4H,5H2,1H3

SMILES: CC(=O)CSc1nc2ccc(cc2s1)N(=O)=O

Synonyms:

• 1-[(6-Nitro-1,3-benzothiazol-2-yl)sulfanyl]acetone
• 2-Propanone, 1-[(6-Nitro-2-Benzothiazolyl)Thio]-

1-[(6-nitro-1,3-benzothiazol-2-yl)thio]acetone

CAS: 532951-91-0

Formula: C₁₀H₈N₂O₃S₂

Purity: 95.0%

Molecular weight: 268.31

Ref: 10-F315398