CAS 532954-30-6

2-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]propanoic acid

Description:

2-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]propanoic acid is a chemical compound characterized by its unique structure, which includes a dihydropyrimidine ring and a propanoic acid moiety. This compound features a sulfanyl group, which contributes to its potential reactivity and biological activity. The presence of an amino group on the pyrimidine ring suggests that it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. The carboxylic acid functional group in the propanoic acid part of the molecule provides acidic properties, allowing it to engage in acid-base reactions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its solubility and stability can be influenced by the pH of the environment, and it may interact with biological targets due to its functional groups. Overall, this compound represents a class of molecules that could have significant implications in drug design and development.

Formula: C₇H₉N₃O₃S

InChI: InChI=1/C7H9N3O3S/c1-3(6(12)13)14-7-9-4(8)2-5(11)10-7/h2-3H,1H3,(H,12,13)(H3,8,9,10,11)

SMILES: CC(C(=O)O)Sc1nc(cc(n1)O)N

Synonyms:

• Propanoic Acid, 2-[(6-Amino-1,4-Dihydro-4-Oxo-2-Pyrimidinyl)Thio]-
• 2-[(6-Amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]propanoic acid

2-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)thio]propanoic acid

CAS: 532954-30-6

Formula: C₇H₉N₃O₃S

Purity: 95.0%

Molecular weight: 215.23

Ref: 10-F315346