CAS 53297-68-0

4-Amino-3-chlorobenzenesulfonamide

Description:

4-Amino-3-chlorobenzenesulfonamide, also known as sulfanilamide, is an organic compound characterized by the presence of an amino group, a sulfonamide group, and a chlorine atom attached to a benzene ring. Its molecular structure features a sulfonamide functional group (-SO2NH2), which is known for its antibacterial properties, making it relevant in medicinal chemistry. This compound is typically a white to off-white crystalline solid and is soluble in water, which enhances its bioavailability. The presence of the amino group contributes to its basicity, while the sulfonamide group is responsible for its pharmacological activity. 4-Amino-3-chlorobenzenesulfonamide is often used in the synthesis of various pharmaceuticals and can act as a precursor in the development of other sulfonamide derivatives. Its chlorine substituent can influence the compound's reactivity and biological activity. Overall, this compound is significant in both industrial applications and research, particularly in the fields of medicinal chemistry and drug development.

Formula: C₆H₇ClN₂O₂S

InChI: InChI=1S/C6H7ClN2O2S/c7-5-3-4(12(9,10)11)1-2-6(5)8/h1-3H,8H2,(H2,9,10,11)

InChI key: InChIKey=LFIOFZKZCDMGFG-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(Cl)=C(N)C=C1

Synonyms:

• 2-Chloro-4-Sulfamoylaniline
• Benzenesulfonamide, 4-amino-3-chloro-
• Sulfanilamide, 3-chloro-
• 4-Amino-3-chlorobenzenesulfonamide

4-Amino-3-chlorobenzenesulfonamide

CAS: 53297-68-0

Formula: C₆H₇ClN₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.6500

Ref: IN-DA0037C6

2-Chloro-4-sulfamoylaniline

CAS: 53297-68-0

2-Chloro-4-sulfamoylaniline

Purity: 98%

Molecular weight: 206.65g/mol

Ref: 54-OR75532

2-Chloro-4-sulfamoylaniline

CAS: 53297-68-0

Formula: C₆H₇ClN₂O₂S

Purity: 98%

Color and Shape: Solid, No data available.

Molecular weight: 206.64

Ref: 10-F433389

2-chloro-4-sulfamoylaniline

CAS: 53297-68-0

2-chloro-4-sulfamoylaniline is a sepharose, which is a type of porous polysaccharide that can be used as an affinity matrix in chromatography. It has been used to purify sulfanilamide from the reaction mixture and to separate ethoxzolamide from lactoperoxidase. The affinity of 2-chloro-4-sulfamoylaniline is determined by the proximity of the enzyme to the surface and its ability to bind with the substrate.
2-chloro-4-sulfamoylaniline has also been shown to deacetylate cyanogen, causing it to form cyanamide. This chemical has polluting effects on water and air due to its aliphatic nature.

Formula: C₆H₇ClN₂O₂S

Purity: Min. 95%

Molecular weight: 206.65 g/mol

Ref: 3D-DCA29768