CAS 53298-29-6: Carbonochloridic acid, 2-(methylsulfonyl)ethyl ester
Description:Carbonochloridic acid, 2-(methylsulfonyl)ethyl ester, with the CAS number 53298-29-6, is an organic compound characterized by its ester functional group and the presence of a chlorocarbonyl moiety. This compound typically exhibits a polar nature due to the presence of the sulfonyl group, which can influence its solubility in various solvents. The methylsulfonyl group contributes to its reactivity, making it a potential intermediate in organic synthesis. The chlorocarbonyl group can participate in nucleophilic acyl substitution reactions, allowing for further functionalization. Additionally, the compound may exhibit moderate volatility and stability under standard conditions, but it should be handled with care due to the potential reactivity of the chlorinated functional groups. Its applications may include use in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, where the unique properties of the methylsulfonyl group can be advantageous. As with many chemical substances, safety precautions should be observed when handling this compound due to potential toxicity and environmental impact.
Formula:C4H7ClO4S
InChI:InChI=1S/C4H7ClO4S/c1-10(7,8)3-2-9-4(5)6/h2-3H2,1H3
InChI key:InChIKey=KRGWSYPAFWHXQI-UHFFFAOYSA-N
SMILES:O=C(Cl)OCCS(=O)(=O)C
- Synonyms:
- 2-(Methylsulfonyl)Ethyl Carbonochloridate
- 2-(Methylsulfonyl)ethyl chloroformate
- 2-Methanesulfonylethyl chloroformate
- Carbonochloridic acid, 2-(methylsulfonyl)ethyl ester
- Methylsulfonylethoxycarbonyl chloride
- Methylsulfonylethyloxycarbonyl group
- 2-Mesylethyl chloroformate
- 2-METHYLSULFONYLETHYL CHLOROCARBONATE
- {2-[(chlorocarbonyl)oxy]ethanesulfonyl}methane
- Chloroformic acid 2-methylsulfonylethyl ester
- See more synonyms
- Einecs 258-463-1
- 2-METHYLSULFONYLETHYL CHLOROCARBONATE 97%
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | {2-[(Chlorocarbonyl)oxy]ethanesulfonyl}methane REF: 3D-DCA29829CAS: 53298-29-6 | Min. 95% | To inquire | Tue 23 Sep 25 |

{2-[(Chlorocarbonyl)oxy]ethanesulfonyl}methane
Ref: 3D-DCA29829
50mg | To inquire | ||
500mg | To inquire |