CAS 533-41-5
:N-(6-amino-1,3-benzothiazol-2-yl)acetamide
Description:
N-(6-amino-1,3-benzothiazol-2-yl)acetamide, with the CAS number 533-41-5, is an organic compound characterized by its benzothiazole structure, which features a fused benzene and thiazole ring. This compound contains an amino group and an acetamide functional group, contributing to its potential biological activity. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound is of interest in medicinal chemistry and may exhibit various pharmacological properties, including antimicrobial or anticancer activities. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C9H9N3OS
InChI:InChI=1/C9H9N3OS/c1-5(13)11-9-12-7-3-2-6(10)4-8(7)14-9/h2-4H,10H2,1H3,(H,11,12,13)
SMILES:CC(=Nc1nc2ccc(cc2s1)N)O
Synonyms:- acetamide, N-(6-amino-2-benzothiazolyl)-
- Acetamide, N-(6-amino-2-benzothiazolyl)- (9CI)
- n-(6-aminobenzo[d]thiazol-2-yl)acetamide
- N-(6-amino-1,3-benzothiazol-2-yl)acetamide(SALTDATA: FREE)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(6-Amino-1,3-benzothiazol-2-yl)acetamide
CAS:N-(6-Amino-1,3-benzothiazol-2-yl)acetamidePurity:≥95%Molecular weight:207.25g/molN-(6-Aminobenzothiazol-2-yl)acetamide
CAS:N-(6-Aminobenzothiazol-2-yl)acetamide is a cyclic molecule that has both optical and electron transfer properties. It is an efficient inhibitor of the enzyme, benzene, which catalyzes the oxidation of benzene to benzoquinone. This compound can be synthesized using a number of techniques, including cyclization by reaction with acetamide. The molecule is a semiconductor with potentiodynamic polarization properties in the region of visible light. This property is useful for optical absorption spectroscopy and voltammetry experiments. Inhibition efficiency can be determined spectroscopically or by kinetic experiments such as measuring the rate of electron transfer between the inhibitor and substrate. The morphology of N-(6-aminobenzothiazol-2-yl)acetamide crystals can be studied using techniques such as X-ray diffraction or scanning electron microscopy.Formula:C9H9N3OSPurity:Min. 95%Molecular weight:207.26 g/mol

