CAS 5330-79-0

4-(2-methylphenyl)-1,3-thiazol-2-amine

Description:

4-(2-Methylphenyl)-1,3-thiazol-2-amine, with the CAS number 5330-79-0, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a 2-methylphenyl group attached to the thiazole, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of an amine functional group indicates that it can participate in hydrogen bonding, which may affect its interactions in biological systems or with other chemical substances. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. However, specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.

Formula: C₁₀H₁₀N₂S

InChI: InChI=1/C10H10N2S/c1-7-4-2-3-5-8(7)9-6-13-10(11)12-9/h2-6H,1H3,(H2,11,12)

SMILES: Cc1ccccc1c1csc(=N)[nH]1

Synonyms:

• 2-Thiazolamine, 4-(2-methylphenyl)-
• 4-(2-Methylphenyl)-1,3-thiazol-2-amine

4-O-Tolyl-thiazol-2-ylamine

CAS: 5330-79-0

Formula: C₁₀H₁₀N₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.2648

Ref: IN-DA003GFU

4-(o-Tolyl)thiazol-2-amine

CAS: 5330-79-0

4-(o-Tolyl)thiazol-2-amine

Purity: 98%

Molecular weight: 190.26g/mol

Ref: 54-OR350382

4- o -Tolyl-thiazol-2-ylamine

CAS: 5330-79-0

Formula: C₁₀H₁₀N₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.26

Ref: 10-F029805

4-(2-Methylphenyl)-1,3-thiazol-2-amine

CAS: 5330-79-0

4-(2-Methylphenyl)-1,3-thiazol-2-amine is a heterocyclic compound that is produced by the oxidation of 4-(2-methylphenyl)furan with nitric acid in ionic liquid. The reaction is carried out in the presence of molecular oxygen (O2) and ammonium nitrate as an oxidant. The yields are low and the product can be volatile and heterocyclic. It is typically used for analytical purposes only.

Purity: Min. 95%

Ref: 3D-FM169199