CAS 5330-84-7

N-(5-chloro-2-methylphenyl)-2-(3-methylphenoxy)acetamide

Description:

N-(5-chloro-2-methylphenyl)-2-(3-methylphenoxy)acetamide, with the CAS number 5330-84-7, is a chemical compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a chloro-substituted aromatic ring, contributing to its potential biological activity and lipophilicity. The presence of the methyl groups on the phenyl rings enhances its hydrophobic character, which may influence its solubility and interaction with biological membranes. The compound's structure suggests it may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of the phenoxy group can enhance its reactivity and stability. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is analyzed. Safety data and handling precautions should be considered due to the presence of chlorine, which can pose health risks.

Formula: C₁₆H₁₆ClNO₂

InChI: InChI=1/C16H16ClNO2/c1-11-4-3-5-14(8-11)20-10-16(19)18-15-9-13(17)7-6-12(15)2/h3-9H,10H2,1-2H3,(H,18,19)

SMILES: Cc1cccc(c1)OCC(=Nc1cc(ccc1C)Cl)O

Synonyms:

• acetamide, N-(5-chloro-2-methylphenyl)-2-(3-methylphenoxy)-

N-​(4-​Nitrobenzoyl)​alanine

CAS: 5330-84-7

N-​(4-​Nitrobenzoyl)​alanine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 238.20g/mol

Ref: 54-OR45223