CAS 5330-97-2
:N-hydroxy-2-phenylacetamide
Description:
N-hydroxy-2-phenylacetamide, also known by its CAS number 5330-97-2, is an organic compound characterized by the presence of both an amide and a hydroxyl functional group. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. This compound is often utilized in organic synthesis and pharmaceutical applications, particularly as an intermediate in the production of various bioactive molecules. Its structure features a phenyl group attached to an acetamide moiety, with a hydroxyl group directly bonded to the nitrogen atom, which can influence its reactivity and interaction with biological systems. N-hydroxy-2-phenylacetamide may exhibit properties such as antioxidant activity and potential use in drug development, although specific biological activities can vary based on the context of its application. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with exposure.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c10-8(9-11)6-7-4-2-1-3-5-7/h1-5,11H,6H2,(H,9,10)
SMILES:c1ccc(cc1)CC(=NO)O
Synonyms:- benzeneacetamide, N-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Hydroxy-2-phenyl-acetamide
CAS:<p>N-Hydroxy-2-phenyl-acetamide is a metalloprotease inhibitor that binds to the active site of the enzyme, thereby preventing it from binding with its natural substrate. This drug has been shown to inhibit the production of TNF-α in mice with autoimmune diseases and may be able to inhibit other proinflammatory mediators. N-Hydroxy-2-phenyl-acetamide has been shown to bind to a water molecule and an aliphatic hydrocarbon in order to form a hydrogen bond. This coordination complex inhibits the activity of matrix metalloproteinases, which are enzymes that break down collagen, elastin, and other proteins in the extracellular matrix. N-Hydroxy-2-phenyl-acetamide is not active against acid complexes or tnfα.</p>Formula:C8H9NO2Purity:Min. 95%Color and Shape:White Yellow PowderMolecular weight:151.16 g/mol




