CymitQuimica logo

CAS 53305-80-9

:

5-fluoro-2,6-dioxohexahydropyrimidine-4-carboxylic acid

Description:
5-Fluoro-2,6-dioxohexahydropyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms. The presence of a fluorine atom at the 5-position and carboxylic acid functionality at the 4-position contributes to its unique chemical properties. The two keto groups at the 2 and 6 positions enhance its reactivity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. Additionally, the presence of fluorine can influence the lipophilicity and metabolic stability of the compound, making it an interesting subject for further research in drug design and development.
Formula:C5H5FN2O4
InChI:InChI=1/C5H5FN2O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h1-2H,(H,10,11)(H2,7,8,9,12)
SMILES:C1(C(C(=O)O)N=C(N=C1O)O)F
Synonyms:
  • 4-Pyrimidinecarboxylic acid, 5-fluorohexahydro-2,6-dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.