CAS 5331-92-0
:3,4-dichlorobenzaldehyde oxime
Description:
3,4-Dichlorobenzaldehyde oxime, with the CAS number 5331-92-0, is an organic compound characterized by the presence of both a benzaldehyde and an oxime functional group. It features a dichlorobenzene ring, where chlorine atoms are substituted at the 3 and 4 positions relative to the aldehyde group. This compound typically appears as a crystalline solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The oxime functional group, characterized by the presence of a nitrogen atom double-bonded to an oxygen atom and single-bonded to a carbon atom, imparts specific reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 3,4-dichlorobenzaldehyde oxime may exhibit biological activity, which can be of interest in medicinal chemistry. Proper handling and safety measures should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C7H5Cl2NO
InChI:InChI=1/C7H5Cl2NO/c8-6-2-1-5(4-10-11)3-7(6)9/h1-4,11H/b10-4+
Synonyms:- 3,4-Dichlorobenzaldoxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-dichlorobenzaldehyde oxime
CAS:<p>3,4-dichlorobenzaldehyde oxime</p>Purity:95Molecular weight:190.03g/mol3,4-Dichlorobenzaldehyde oxime
CAS:<p>3,4-Dichlorobenzaldehyde oxime is a natural carotenoid that has been shown to have antibacterial activity. 3,4-Dichlorobenzaldehyde oxime is produced by the reaction of malonate and aldehyde in an incubated system. This compound has been shown to be active against Gram-positive bacteria such as staphylococcus and aldoximes and Gram-negative bacteria such as E. coli, Salmonella typhimurium, and Shigella flexneri. 3,4-Dichlorobenzaldehyde oxime inhibits bacterial growth by binding to the 50S ribosomal subunit of the bacterial cell membrane. This binding prevents protein synthesis, leading to cell death. The biosynthesis of 3,4-dichlorobenzaldehyde oxime involves the conversion of abscisic acid (ABA) into ABA quinone through oxidation by an enzyme called ABA oxidase</p>Formula:C7H5Cl2NOPurity:Min. 95%Color and Shape:PowderMolecular weight:190.03 g/mol
![(E)-N-[(3,4-dichlorophenyl)methylidene]hydroxylamine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA003IG0.jpg&w=3840&q=75)
