CAS 53313-95-4
:hydroxy(3-hydroxyphenyl)acetonitrile
Description:
Hydroxy(3-hydroxyphenyl)acetonitrile, with the CAS number 53313-95-4, is an organic compound characterized by the presence of both hydroxyl and nitrile functional groups. It features a phenolic structure, specifically a 3-hydroxyphenyl group, which contributes to its potential reactivity and solubility in polar solvents. The acetonitrile moiety indicates that it contains a carbon atom bonded to a cyano group (–C≡N), which can influence its chemical behavior, particularly in nucleophilic reactions. This compound may exhibit properties such as moderate polarity and the ability to participate in hydrogen bonding due to the hydroxyl group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific physical properties like melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.
Formula:C8H7NO2
InChI:InChI=1/C8H7NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,8,10-11H
SMILES:c1cc(cc(c1)O)C(C#N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Mandelonitrile, m-hydroxy-
CAS:Mandelonitrile, m-hydroxy- is a bioactive chemical.Formula:C8H7NO2Color and Shape:SolidMolecular weight:149.153-Hydroxymandelonitrile
CAS:Controlled Product<p>Applications 3-Hydroxymandelonitrile (cas# 53313-95-4) is a compound useful in organic synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C8H7NO2Color and Shape:NeatMolecular weight:149.15

