CAS 53319-52-1

9-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]-7H-furo[3,2-g]chromen-7-one

Description:

The chemical substance known as 9-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]-7H-furo[3,2-g]chromen-7-one, with the CAS number 53319-52-1, is a naturally occurring flavonoid compound. It features a complex structure that includes a chromone core fused with a furan ring, which contributes to its unique chemical properties. This compound is characterized by the presence of a hydroxyl group and an alkene side chain, which can influence its reactivity and biological activity. Flavonoids like this one are known for their antioxidant properties and potential health benefits, including anti-inflammatory and anti-cancer effects. The presence of the hydroxy and alkene functionalities suggests that it may participate in various chemical reactions, such as oxidation or conjugation. Additionally, its solubility and stability can be affected by the surrounding pH and solvent conditions. Overall, this compound is of interest in both pharmacological research and natural product chemistry due to its potential therapeutic applications.

Formula: C₁₆H₁₄O₅

InChI: InChI=1/C16H14O5/c1-9(2)12(17)8-20-16-14-11(5-6-19-14)7-10-3-4-13(18)21-15(10)16/h3-7,12,17H,1,8H2,2H3

SMILES: C=C(C)C(COc1c2c(cco2)cc2ccc(=O)oc12)O

Synonyms:

• 7H-Furo(3,2-g)(1)benzopyran-7-one, 9-((2-hydroxy-3-methyl-3-butenyl)oxy)-
• 7H-furo[3,2-g][1]benzopyran-7-one, 9-[(2-hydroxy-3-methyl-3-buten-1-yl)oxy]-
• 9-((2-Hydroxy-3-methyl-3-butenyl)oxy)-7H-furo(3,2-g)(1)benzopyran-7-one

Isogosferol

CAS: 53319-52-1

Isogosferol is a minor furocoumarin of Murraya koenigii seeds.

Formula: C₁₆H₁₄O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 286.28

Ref: TM-TN4295

Isogosferol

CAS: 53319-52-1

Formula: C₁₆H₁₄O₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 286.283

Ref: BP-SBP00765

Isogosferol

CAS: 53319-52-1

Isogosferol is a synthetic compound, which is derived from laboratory processes involving organic synthesis techniques. It functions primarily by inhibiting inflammatory pathways in biological systems, specifically targeting the NF-kB signaling pathway to reduce the expression of pro-inflammatory cytokines. This mechanism of action makes Isogosferol a potent anti-inflammatory agent.

Formula: C₁₆H₁₄O₅

Purity: Min. 95%

Molecular weight: 286.28 g/mol

Ref: 3D-DCA31952