CAS 5332-70-7

2-bromo-N-(4-sulfamoylphenyl)acetamide

Description:

2-bromo-N-(4-sulfamoylphenyl)acetamide, with the CAS number 5332-70-7, is a chemical compound characterized by its structural features, which include a bromine atom, an acetamide group, and a sulfonamide moiety. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the sulfonamide functional group, which enhances its hydrophilicity. The bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The sulfonamide group is known for its biological activity, often contributing to the compound's pharmacological properties. This compound may be utilized in medicinal chemistry and research, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. Its synthesis and characterization would involve standard organic chemistry techniques, and safety precautions should be observed due to the presence of bromine and sulfonamide functionalities, which may pose health risks.

Formula: C₈H₉BrN₂O₃S

InChI: InChI=1/C8H9BrN2O3S/c9-5-8(12)11-6-1-3-7(4-2-6)15(10,13)14/h1-4H,5H2,(H,11,12)(H2,10,13,14)

SMILES: c1cc(ccc1NC(=O)CBr)S(=O)(=O)N

N-[4-(aminosulphonyl)phenyl]-2-bromoacetamide

CAS: 5332-70-7

N-[4-(aminosulphonyl)phenyl]-2-bromoacetamide

Purity: ≥95%

Molecular weight: 293.14g/mol

Ref: 54-OR27240