CAS 5333-45-9

1,2,3,5-Tetramethoxybenzene

Description:

1,2,3,5-Tetramethoxybenzene is an organic compound characterized by a benzene ring substituted with four methoxy groups (-OCH3) at the 1, 2, 3, and 5 positions. This compound is a member of the methoxy-substituted aromatic hydrocarbons and is known for its potential applications in organic synthesis and as a precursor in the development of various chemical compounds. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of multiple methoxy groups enhances its solubility in organic solvents and can influence its reactivity, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting electronic properties due to the electron-donating nature of the methoxy groups, which can affect its behavior in chemical reactions and interactions with other substances. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₁₄O₄

InChI: InChI=1/C10H14O4/c1-11-7-5-8(12-2)10(14-4)9(6-7)13-3/h5-6H,1-4H3

SMILES: COc1cc(c(c(c1)OC)OC)OC

1,2,3,5-Tetramethoxybenzene

CAS: 5333-45-9

Formula: C₁₀H₁₄O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.2158

Ref: IN-DA003DAF

1,2,3,5-Tetramethoxybenzene

CAS: 5333-45-9

Formula: C₁₀H₁₄O₄

Molecular weight: 198.22

Ref: 4Z-B-085058

1,2,3,5-Tetramethoxybenzene

Controlled Product

CAS: 5333-45-9

1,2,3,5-Tetramethoxybenzene is a tannin that belongs to the class of arenes. It can be synthesized by Friedel-Crafts acylation of benzene with an acyl chloride in the presence of aluminum chloride. This reaction produces 1,2,3,5-tetramethoxybenzene and triketone as byproducts. The synthetic pathway for this compound is based on techniques such as irradiation and thermally induced rearrangement. The oxidized form has a redox potential of -0.6 V vs NHE (normal hydrogen electrode). Methoxy groups on the aromatic ring increase the electron affinity and lower the redox potential.

Formula: C₁₀H₁₄O₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 198.22 g/mol

Ref: 3D-FT68065