CymitQuimica logo

CAS 53330-02-2

:

S-[[(2-Phenylethyl)amino]thioxomethyl]-L-cysteine

Description:
S-[[(2-Phenylethyl)amino]thioxomethyl]-L-cysteine, with the CAS number 53330-02-2, is a sulfur-containing amino acid derivative. This compound features a thioxomethyl group attached to the sulfur atom of the cysteine backbone, which contributes to its unique chemical properties. The presence of the 2-phenylethylamino group enhances its potential for biological activity, possibly influencing interactions with various biological targets. The structure includes both an amino group and a carboxylic acid group, characteristic of amino acids, allowing it to participate in peptide bond formation. Its thioether functionality may also play a role in redox reactions and interactions with metal ions. This compound is of interest in medicinal chemistry and biochemistry due to its potential applications in drug development and as a biochemical probe. However, specific details regarding its solubility, stability, and reactivity would depend on the conditions under which it is studied. Overall, S-[[(2-Phenylethyl)amino]thioxomethyl]-L-cysteine represents a fascinating intersection of amino acid chemistry and medicinal applications.
Formula:C12H16N2O2S2
InChI:InChI=1S/C12H16N2O2S2/c13-10(11(15)16)8-18-12(17)14-7-6-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2,(H,14,17)(H,15,16)/t10-/m0/s1
InChI key:InChIKey=FWNOABWJBHBVKJ-JTQLQIEISA-N
SMILES:C(CNC(SC[C@@H](C(O)=O)N)=S)C1=CC=CC=C1
Synonyms:
  • L-Cysteine, (2-phenylethyl)carbamodithioate (ester)
  • S-[[(2-Phenylethyl)amino]thioxomethyl]-L-cysteine
  • L-Cysteine, S-[[(2-phenylethyl)amino]thioxomethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.