CAS 53336-42-8
:Thiophene, 3-bromo-2,3-dihydro-, 1,1-dioxide
Description:
Thiophene, 3-bromo-2,3-dihydro-, 1,1-dioxide, with the CAS number 53336-42-8, is a heterocyclic organic compound characterized by its thiophene ring structure, which includes a sulfur atom in a five-membered ring. This compound features a bromine substituent at the 3-position and has two additional oxygen atoms that contribute to its 1,1-dioxide classification, indicating the presence of sulfone groups. The dihydro designation suggests that the compound has two additional hydrogen atoms, resulting in a saturated form of thiophene. This compound exhibits properties typical of thiophene derivatives, such as aromaticity and potential reactivity in electrophilic substitution reactions. Its unique structure may impart specific physical and chemical properties, including solubility in organic solvents and potential applications in organic synthesis or materials science. The presence of the bromine atom can enhance its reactivity, making it a useful intermediate in various chemical reactions. Overall, thiophene derivatives are of interest in fields such as pharmaceuticals, agrochemicals, and organic electronics.
Formula:C4H5BrO2S
InChI:InChI=1S/C4H5BrO2S/c5-4-1-2-8(6,7)3-4/h1-2,4H,3H2
InChI key:InChIKey=OFHNLUNDNLABJQ-UHFFFAOYSA-N
SMILES:O=S1(=O)CC(Br)C=C1
Synonyms:- (3R)-3-bromo-2,3-dihydrothiophene 1,1-dioxide
- (3S)-3-bromo-2,3-dihydrothiophene 1,1-dioxide
- 3-Bromo-2,3-dihydro-1λ6-thiophene-1,1-dione
- 3-Bromo-2,3-dihydro-thiophene 1,1-dioxide
- 3-Bromo-2,3-dihydrothiophene dioxide
- 4-Bromo-2-sulfolene
- NSC 227878
- Thiophene, 3-Bromo-2,3-Dihydro-, 1,1-Dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-2,3-dihydrothiophene 1,1-dioxide
CAS:Formula:C4H5BrO2SPurity:97%Color and Shape:SolidMolecular weight:197.05033-Bromo-2,3-dihydrothiophene 1,1-dioxide
CAS:3-Bromo-2,3-dihydrothiophene 1,1-dioxidePurity:96%Molecular weight:197.05g/mol3-Bromo-2,3-dihydrothiophene 1,1-dioxide
CAS:3-Bromo-2,3-dihydrothiophene 1,1-dioxide is a synthetic chemical that has been shown to react with magnesium in an ionic liquid to form 3-bromo-2,3-dihydrothiophene. This compound can be analyzed using elemental analysis and organic reactions. It has been studied extensively for its use as a catalyst in organic reactions such as alkylation and nucleophilic substitution. This compound also has a number of congener groups including the alizarin group, the naphthalene group, and the monocyclic group. 3-Bromo-2,3-dihydrothiophene 1,1-dioxide is also used for the synthesis of sodium salicylate.Formula:C4H5BrO2SPurity:Min. 95%Molecular weight:197.05 g/mol



