CAS 53339-53-0
:4-Mercaptobenzyl Alcohol
Description:
4-Mercaptobenzyl alcohol, with the CAS number 53339-53-0, is an organic compound characterized by the presence of both a thiol (-SH) and a hydroxyl (-OH) functional group attached to a benzyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its strong odor, which is characteristic of thiols. The presence of the thiol group imparts notable reactivity, allowing it to participate in various chemical reactions, such as oxidation and nucleophilic substitution. 4-Mercaptobenzyl alcohol is soluble in organic solvents and exhibits moderate solubility in water due to the polar hydroxyl group. It is often used in organic synthesis, as a reducing agent, and in the production of various chemical intermediates. Additionally, its unique properties make it a candidate for applications in pharmaceuticals, materials science, and as a potential antioxidant. Safety precautions should be taken when handling this compound, as thiols can be toxic and have strong odors.
Formula:C7H8OS
InChI:InChI=1/C7H8OS/c8-5-6-1-3-7(9)4-2-6/h1-4,8-9H,5H2
SMILES:c1cc(ccc1CO)S
Synonyms:- (4-Sulfanylphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzenemethanol,4-mercapto-
CAS:Formula:C7H8OSPurity:90%Color and Shape:SolidMolecular weight:140.20284-Mercaptobenzyl alcohol, 90%
CAS:<p>4-Mercaptobenzyl alcohol (MBBA) is a bifunctional molecule that can act as an electron donor and electron acceptor. It has been shown to have proapoptotic activity, which may be due to its ability to interact with cellular components and induce DNA damage. MBBA has also been shown to inhibit the growth of bacteria by attacking their cell walls and inhibiting their ability to synthesize proteins. The antibacterial activity of MBBA was found to be enhanced on metal surfaces, such as aluminum and copper, which are commonly used in cancer therapy equipment or for antimicrobial resistance. MBBA also has diagnostic properties, which can be used for the detection of cancer cells or bacterial infections.<br>MBBA is absorbed into cells through the carboxylate groups on the surface of the cell membrane. Electrons are then transferred from the molecule to the cell's electron transport chain, thereby increasing ATP production and inducing apoptosis in cancer cells.</p>Formula:C7H8OSPurity:Min. 90%Color and Shape:Off-White PowderMolecular weight:140.2 g/mol4-Mercaptobenzyl Alcohol, 90%
CAS:Controlled Product<p>Stability Dimerizes Readily - Store Under Inert Atmosphere<br>Applications 4-Mercaptobenzyl Alcohol, 90% (cas# 53339-53-0) is a compound useful in organic synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C7H8OSPurity:90%Color and Shape:NeatMolecular weight:140.20
