CAS 53347-49-2
:2,2'-sulfonyldianiline
Description:
2,2'-Sulfonyldianiline, with the CAS number 53347-49-2, is an organic compound characterized by the presence of two aniline groups connected by a sulfonyl (-SO2-) bridge. This compound typically appears as a solid and is known for its utility in various chemical applications, including as a precursor in the synthesis of dyes and polymers. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many sulfonamide derivatives. The sulfonyl group contributes to its reactivity, making it a potential candidate for further chemical modifications. Additionally, 2,2'-sulfonyldianiline may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data indicates that, like many aromatic amines, it should be handled with care due to potential health hazards, including carcinogenicity. Overall, 2,2'-sulfonyldianiline is a versatile compound with significant relevance in both industrial and research settings.
Formula:C12H12N2O2S
InChI:InChI=1/C12H12N2O2S/c13-9-5-1-3-7-11(9)17(15,16)12-8-4-2-6-10(12)14/h1-8H,13-14H2
SMILES:c1ccc(c(c1)N)S(=O)(=O)c1ccccc1N
Synonyms:- 2,2'-Sulfonylbisbenzenamine
- 2-[(2-Aminophenyl)Sulfonyl]Aniline
- 2-[(2-Aminophenyl)sulfonyl]phenylamine
- Benzenamine, 2,2'-sulfonylbis-
- Sulfonyldianiline
- Sulphonyldianiline
- Bis(2-aminophenyl) sulfone
- Dapsone Impurity 12
- 2,2'-Diamino[sulfonylbisbenzene]
- 2,2'-Sulfonylbis(benzenamine)
- 2,2''-Sulfonyldianiline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Bis(2-aminophenyl) Sulfone
CAS:Controlled ProductFormula:C12H12N2O2SColor and Shape:NeatMolecular weight:248.301


