CAS 5335-23-9

1-(4-chlorophenoxy)propan-2-ol

Description:

1-(4-Chlorophenoxy)propan-2-ol, with the CAS number 5335-23-9, is an organic compound characterized by its structure, which includes a propanol backbone substituted with a 4-chlorophenoxy group. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in water, influenced by the presence of the hydroxyl (-OH) group. The chlorophenoxy moiety contributes to its potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit properties such as antimicrobial or herbicidal activity, depending on its specific application. Its molecular structure allows for hydrogen bonding, which can affect its reactivity and interactions with other substances. Safety data sheets indicate that it should be handled with care, as it may pose risks such as skin irritation or environmental hazards. Overall, 1-(4-chlorophenoxy)propan-2-ol is a versatile compound with significant implications in chemical research and application.

Formula: C₉H₁₁ClO₂

InChI: InChI=1/C9H11ClO2/c1-7(11)6-12-9-4-2-8(10)3-5-9/h2-5,7,11H,6H2,1H3

SMILES: CC(COc1ccc(cc1)Cl)O

Synonyms:

• 2-Propanol, 1- (4-chlorophenoxy)-
• 2-Propanol, 1-(p-chlorophenoxy)-