
CAS 5335-87-5
:Bis(4-methoxyphenyl) disulphide
Description:
Bis(4-methoxyphenyl) disulphide, with the CAS number 5335-87-5, is an organic compound characterized by its disulphide linkage between two 4-methoxyphenyl groups. This compound typically appears as a yellow to light brown solid and is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water. The presence of the methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions with other chemical species. Bis(4-methoxyphenyl) disulphide is often studied for its potential applications in organic synthesis, materials science, and as a precursor in the development of various chemical products. Its disulphide bond can undergo reduction, making it a subject of interest in redox chemistry. Additionally, the compound may exhibit antioxidant properties, which could be relevant in biological and pharmaceutical contexts. Overall, its unique structure and functional groups contribute to its diverse chemical behavior and potential applications.
Formula:C19H25NO
InChI:InChI=1/C19H25NO/c1-13(17-5-3-2-4-6-17)20-18(21)19-10-14-7-15(11-19)9-16(8-14)12-19/h2-6,13-16H,7-12H2,1H3,(H,20,21)
SMILES:CC(c1ccccc1)N=C(C12CC3CC(CC(C3)C2)C1)O
Synonyms:- 4-Methoxyphenyl disulphide
- 1,1'-Disulfanediylbis(4-Methoxybenzene)
- N-(1-phenylethyl)tricyclo[3.3.1.1~3,7~]decane-1-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bis(4-methoxyphenyl)disulfide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H14O2S2Purity:97%Color and Shape:White to cream to yellow to pale brown to brown, Crystals or crystalline powder or powder or fused solidMolecular weight:278.38Disulfide, bis(4-methoxyphenyl)
CAS:Formula:C14H14O2S2Purity:97%Color and Shape:SolidMolecular weight:278.3898Bis(4-methoxyphenyl) disulphide
CAS:Bis(4-methoxyphenyl) disulphideFormula:C14H14O2S2Purity:98%Color and Shape: dark yellow to brown fused solidMolecular weight:278.39g/mol



