CAS 53350-26-8
:3′,4′,5,5′,7-Pentamethoxyflavone
Description:
3′,4′,5,5′,7-Pentamethoxyflavone, with the CAS number 53350-26-8, is a flavonoid compound characterized by the presence of five methoxy groups attached to its flavone backbone. This structure contributes to its unique chemical properties, including enhanced lipophilicity and potential biological activity. The methoxy substitutions can influence the compound's solubility, stability, and interaction with biological targets. Flavonoids, in general, are known for their antioxidant properties, and pentamethoxyflavone has been studied for its potential health benefits, including anti-inflammatory and anticancer effects. Its molecular structure allows it to interact with various enzymes and receptors, making it a subject of interest in pharmacological research. Additionally, the compound may exhibit UV-absorbing properties, which can be relevant in applications such as cosmetics and food preservation. Overall, 3′,4′,5,5′,7-Pentamethoxyflavone represents a significant compound within the flavonoid class, with promising implications for health and wellness.
Formula:C20H20O7
InChI:InChI=1S/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3
InChI key:InChIKey=GIKVSFNAEBQLGB-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=CC(OC)=C(OC)C(OC)=C3)=CC(OC)=C1
Synonyms:- 3',4',5',5,7-Pentamethoxyflavone
- 3′,4′,5,5′,7-Pentamethoxyflavone
- 4H-1-Benzopyran-4-one, 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-
- 5,7,3′,4′,5′-Pentamethoxyflavone
- 5,7-Dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one
- 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one
- Flavone, 3′,4′,5,5′,7-pentamethoxy-
- Tricetin pentamethyl ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Tricetin-3',4',5',5,7-pentamethylether
CAS:Tricetin-3',4',5',5,7-pentamethylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C20H20O7Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:372.383',4',5',5,7-Pentamethoxyflavone
CAS:Formula:C20H20O7Purity:95%Color and Shape:SolidMolecular weight:372.36863',4',5',5,7-Pentamethoxyflavone
CAS:3',4',5',5,7-PentamethoxyflavonePurity:≥98%Molecular weight:372.37g/mol3',4',5',5,7-Pentamethoxyflavone
CAS:<p>3',4',5',5,7-Pentamethoxyflavone, a Rutaceae brassinosteroid, thwarts cancer by blocking Nrf2, aiding chemotherapy.</p>Formula:C20H20O7Purity:99.26%Color and Shape:Off-White Crystalline SolidMolecular weight:372.373',4',5',5,7-Pentamethoxyflavone
CAS:<p>3',4',5',5,7-Pentamethoxyflavone is a synthetic flavonoid compound, which is derived from the structural modification of naturally occurring flavonoids found in various plants. The compound is specifically produced for research and development purposes, exploring its biological and pharmacological potential. The mode of action involves interaction with various cellular pathways, including modulation of enzyme activity, influence on cell signaling pathways, and potential antioxidant properties due to its polyphenolic structure.</p>Formula:C20H20O7Purity:Min. 95%Color and Shape:PowderMolecular weight:372.37 g/mol






