CAS 5337-88-2
:3-methyl-5-phenylcyclohex-2-en-1-one
Description:
3-Methyl-5-phenylcyclohex-2-en-1-one, with the CAS number 5337-88-2, is an organic compound characterized by its cyclohexene structure featuring a ketone functional group. This compound has a double bond in its cyclohexene ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of both a methyl group and a phenyl group on the cyclohexene ring influences its physical and chemical properties, such as solubility and boiling point. Typically, compounds of this nature exhibit moderate polarity due to the ketone group, allowing for interactions with various solvents. Additionally, the structure suggests potential for electrophilic reactions, making it a candidate for further chemical transformations. Its unique arrangement of substituents may also impart specific optical properties, which can be relevant in fields such as materials science and pharmaceuticals. Overall, 3-methyl-5-phenylcyclohex-2-en-1-one is of interest for its synthetic utility and potential applications in various chemical processes.
Formula:C13H14O
InChI:InChI=1/C13H14O/c1-10-7-12(9-13(14)8-10)11-5-3-2-4-6-11/h2-6,8,12H,7,9H2,1H3
SMILES:CC1=CC(=O)CC(C1)c1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Methyl-5-phenylcyclohex-2-en-1-one
CAS:3-Methyl-5-phenylcyclohex-2-en-1-one is an organic compound that belongs to the class of cyano compounds. This agent is a colorless, oily liquid with a peculiar odor. 3-Methyl-5-phenylcyclohex-2-en-1-one has been used as a solvent for acetoacetate and solvents. The use of this agent in the synthesis of ethyl benzoylacetate has been reported. The axial orientation of the methyl group and the orientations of the phenyl ring have been optimized in order to achieve a conformation that does not lead to steric hindrance during the reaction. A sodium ethoxide solution was used as an additive to promote nucleophilic attack on the carbonyl group in order to obtain ethyl acetoacetate.
Formula:C13H14OPurity:Min. 95%Molecular weight:186.25 g/mol
