CymitQuimica logo

CAS 53371-79-2

:

5-[3-(tert-butylamino)-2-hydroxypropoxy]quinolin-2(1H)-one hydrochloride

Description:
5-[3-(tert-Butylamino)-2-hydroxypropoxy]quinolin-2(1H)-one hydrochloride, with the CAS number 53371-79-2, is a chemical compound that exhibits characteristics typical of quinoline derivatives. This substance features a quinolinone core, which is known for its biological activity, particularly in medicinal chemistry. The presence of a tert-butylamino group enhances its lipophilicity, potentially improving its ability to cross biological membranes. The hydroxypropoxy substituent contributes to its solubility and may influence its pharmacokinetic properties. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous solutions, making it suitable for various formulations. This compound may exhibit various biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Overall, its structural features suggest potential utility in pharmaceutical applications, particularly in drug development targeting specific biological pathways.
Formula:C16H23ClN2O3
InChI:InChI=1/C16H22N2O3.ClH/c1-16(2,3)17-9-11(19)10-21-14-6-4-5-13-12(14)7-8-15(20)18-13;/h4-8,11,17,19H,9-10H2,1-3H3,(H,18,20);1H
SMILES:CC(C)(C)NCC(COc1cccc2c1ccc(n2)O)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.