
CAS 53377-54-1
:Siderin
Description:
Siderin, with the CAS number 53377-54-1, is a complex iron-containing protein that plays a crucial role in iron storage within biological systems. It is primarily found in various organisms, including plants and animals, where it serves to sequester iron ions, thus preventing free iron from catalyzing harmful oxidative reactions. Siderin is characterized by its ability to bind iron in a non-toxic form, facilitating its availability for essential biological processes while minimizing potential damage from excess iron. The protein typically exhibits a high affinity for iron, and its structure often includes a ferritin-like shell that encapsulates the iron core. This characteristic allows siderin to maintain iron homeostasis, which is vital for numerous cellular functions, including oxygen transport and electron transfer. Additionally, siderin's properties can vary depending on the source organism and environmental conditions, influencing its solubility, stability, and interaction with other biomolecules. Overall, siderin is an essential component of the iron metabolism pathway, contributing to the overall health and functionality of living organisms.
Formula:C12H12O4
InChI:InChI=1S/C12H12O4/c1-7-4-8(14-2)5-10-12(7)9(15-3)6-11(13)16-10/h4-6H,1-3H3
InChI key:InChIKey=LLTOPKQGFAAMKH-UHFFFAOYSA-N
SMILES:O(C)C=1C=2C(=CC(OC)=CC2C)OC(=O)C1
Synonyms:- Siderine
- 4,7-Dimethoxy-5-methylcoumarin
- 4,7-Dimethoxy-5-methyl-2H-1-benzopyran-2-one
- Siderin
- 2H-1-Benzopyran-2-one, 4,7-dimethoxy-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Siderin
CAS:Siderin, a Photosystem II inhibitor, effectively impedes ATP synthesis and chloroplast electron transport in photosynthesis within isolated spinach chloroplastsFormula:C12H12O4Color and Shape:SolidMolecular weight:220.22
