CAS 53387-67-0

2-furyl-phenyl-methanamine hydrochloride

Description:

2-Furyl-phenyl-methanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a furyl group and a phenyl group attached to a methanamine backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the hydrochloride salt form enhances its solubility and stability. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. The compound's molecular structure allows for potential interactions with biological systems, which can be explored in medicinal chemistry. As with many amines, it may also participate in various chemical reactions, such as alkylation or acylation, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₂ClNO

InChI: InChI=1/C11H11NO.ClH/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9;/h1-8,11H,12H2;1H

SMILES: c1ccc(cc1)C(c1ccco1)N.Cl

Synonyms:

• 1-(2-Furyl)-1-phenylmethanamine hydrochloride (1:1)
• 2-Furanmethanamine, α-phenyl-, hydrochloride (1:1)

C-Furan-2-yl-C-phenyl-methylaminehydrochloride

CAS: 53387-67-0

Versatile small molecule scaffold

Formula: C₁₁H₁₂ClNO

Purity: Min. 95%

Molecular weight: 209.67 g/mol

Ref: 3D-DCA38767