CAS 53391-72-3
:6-chloro-7-hydroxy-4-phenyl-2H-chromen-2-one
Description:
6-Chloro-7-hydroxy-4-phenyl-2H-chromen-2-one, also known by its CAS number 53391-72-3, is a synthetic organic compound belonging to the class of flavonoids, specifically the chromone derivatives. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at the 6-position with a chlorine atom and at the 7-position with a hydroxyl group. The presence of a phenyl group at the 4-position enhances its aromatic character and may contribute to its biological activity. This compound exhibits potential antioxidant and anti-inflammatory properties, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in various chemical and biological assays. Additionally, the presence of halogen and hydroxyl functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Overall, 6-chloro-7-hydroxy-4-phenyl-2H-chromen-2-one represents a versatile structure with potential applications in medicinal chemistry.
Formula:C15H9ClO3
InChI:InChI=1/C15H9ClO3/c16-12-6-11-10(9-4-2-1-3-5-9)7-15(18)19-14(11)8-13(12)17/h1-8,17H
SMILES:c1ccc(cc1)c1cc(=O)oc2cc(c(cc12)Cl)O
Synonyms:- 2H-1-benzopyran-2-one, 6-chloro-7-hydroxy-4-phenyl-
- 6-Chloro-7-hydroxy-4-phenyl-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Chloro-7-hydroxy-4-phenyl-2H-chromen-2-one
CAS:6-Chloro-7-hydroxy-4-phenyl-2H-chromen-2-one (6CHC) is a chromene derivative that binds to nuclear DNA and can be used for the diagnosis of cancer. 6CHC has been shown to inhibit the growth of cancer cells by binding to their nuclear DNA. The compound has also been shown to bind to the PPAR receptors and thereby inhibiting the proliferation of cancer cells. 6CHC has been shown to be a more sustainable alternative for phaseolus, which is currently being used as an inhibitor in wastewater treatment. This compound is resistant to acid molecules, making it a good candidate for use in wastewater treatment with high concentrations of acid. 6CHC is also an antioxidant that can be used as an corrosion inhibitor in wastewater treatment systems.Formula:C15H9ClO3Purity:Min. 95%Molecular weight:272.68 g/mol
