CAS 53398-55-3
:1-bromo-3,5,7-trimethyltricyclo[3.3.1.1~3,7~]decane
Description:
1-Bromo-3,5,7-trimethyltricyclo[3.3.1.1^3,7]decane is a complex organic compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. The presence of bromine as a substituent at the first position and three methyl groups at the third, fifth, and seventh positions contributes to its chemical reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure imparts significant steric hindrance, influencing its reactivity and interactions with other chemical species. The bromine atom can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound's tricyclic framework may exhibit unique conformational properties, affecting its boiling point, melting point, and solubility in various solvents. Overall, 1-bromo-3,5,7-trimethyltricyclo[3.3.1.1^3,7]decane is of interest in synthetic organic chemistry and may have applications in the development of pharmaceuticals or agrochemicals.
Formula:C13H21Br
InChI:InChI=1/C13H21Br/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11/h4-9H2,1-3H3
SMILES:CC12CC3(C)CC(C)(C1)CC(C2)(C3)Br
Synonyms:- 1-Bromo-3,5,7-Trimethyladamantane
- Tricyclo[3.3.1.1~3,7~]Decane, 1-Bromo-3,5,7-Trimethyl-
- 1-Bromo-3,5,7-trimethyltricyclo[3.3.1.1~3,7~]decane
- (3s,5s,7s)-1-bromo-3,5,7-trimethyladamantane
- Memantine Impurity 3
- Tricyclo[3.3.1.13,7]decane, 1-bromo-3,5,7-trimethyl-
- NSC 251758
- Adamantane Impurity 1 (1-Bromo-3,5,7-Trimethyl Adamantane)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Bromo-3,5,7-trimethyladamantane
CAS:Formula:C13H21BrPurity:98%Color and Shape:SolidMolecular weight:257.20981-Bromo-3,5,7-trimethyladamantane
CAS:1-Bromo-3,5,7-trimethyladamantaneFormula:C13H21BrPurity:≥95%Color and Shape: colourless to white crystalsMolecular weight:257.21g/molAdamantane Impurity 1 (1-Bromo-3,5,7-Trimethyl Adamantane)
CAS:Formula:C13H21BrColor and Shape:White To Off-White SolidMolecular weight:257.221-Bromo-3,5,7-trimethyladamantane
CAS:Controlled ProductApplications 1-Bromo-3,5,7-trimethyladamantane is used as a reagent to synthesize Memantine (M218000) derivatives. Memantine is used as an antiparkinsonian and antispasmodic.
References Henkel, J., et al.: J. Med. Chem., 25, 51 (1982); Rohde, H., et al.: Fortschr. Med., 100, 2023 (1982), Kornhuber, J., et al.: Eur. J. Pharmacol., 166, 589 (1989), Gortelmeyer, R. and Erbler, H.: Arzneimittel-Forsch., 42, 904 (1992)Formula:C13H21BrColor and Shape:NeatMolecular weight:257.211-Bromo-3,5,7-trimethyladamantane
CAS:1-Bromo-3,5,7-trimethyladamantane is a hydroxy adamantane. It is the simplest member of the class of compounds known as adamantanes. Adamantanes are electrophilic and react with nucleophiles to form adducts. 1-Bromo-3,5,7-trimethyladamantane has a bridgehead methyl group that reacts with nucleophiles such as hydroxide ion, forming an ether adduct of the type (CH)O-(CH)Br (1). The carboxylic acid group can be deprotonated by strong bases to form the corresponding anion (CH)O-(CH)COH (2), which reacts with nucleophiles such as amines to give salts of the type (CH)N+(CH)COH (3).Formula:C13H21BrPurity:Min. 95%Molecular weight:257.21 g/mol





