CAS 534-87-2
:Etilefrine hydrochloride
Description:
Etilefrine hydrochloride, with the CAS number 534-87-2, is a synthetic sympathomimetic agent primarily used as a vasopressor and in the treatment of hypotension. It is a derivative of phenylephrine and acts primarily as an alpha-adrenergic agonist, leading to vasoconstriction and increased blood pressure. The compound is typically presented as a hydrochloride salt, which enhances its solubility in water, making it suitable for various pharmaceutical formulations. Etilefrine is characterized by its ability to stimulate the cardiovascular system, thereby improving blood flow and oxygen delivery to tissues. It is often administered in clinical settings for patients experiencing low blood pressure due to various conditions, including shock or during anesthesia. The substance is generally well-tolerated, but like other sympathomimetics, it may have side effects such as increased heart rate, palpitations, or hypertension. Its pharmacokinetics involve rapid absorption and metabolism, with effects that can vary based on individual patient factors and the specific clinical context in which it is used.
Formula:C10H15NO2·ClH
InChI:InChI=1S/C10H15NO2.ClH/c1-2-11-7-10(13)8-4-3-5-9(12)6-8;/h3-6,10-13H,2,7H2,1H3;1H
InChI key:InChIKey=KTNROWWHOBZQGK-UHFFFAOYSA-N
SMILES:C(CNCC)(O)C1=CC(O)=CC=C1.Cl
Synonyms:- Benzenemethanol, α-[(ethylamino)methyl]-3-hydroxy-, hydrochloride (1:1)
- α-[(Ethylamino)methyl]-m-hydroxybenzyl alcohol hydrochloride
- Benzyl alcohol, α-[(ethylamino)methyl]-m-hydroxy-, hydrochloride
- 1-(3-Hydroxyphenyl)-2-ethylaminoethanol hydrochloride
- Benzenemethanol, α-[(ethylamino)methyl]-3-hydroxy-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
