CAS 5344-97-8

3,5-dimethyl-4-nitrophenol

Description:

3,5-Dimethyl-4-nitrophenol, with the CAS number 5344-97-8, is an organic compound that belongs to the class of nitrophenols. It features a phenolic structure with two methyl groups located at the 3 and 5 positions and a nitro group at the 4 position of the aromatic ring. This compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents and limited solubility in water. It is known for its acidic properties, with a pKa indicating its ability to donate a proton in solution. The presence of the nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and making it useful in various chemical applications, including as an intermediate in the synthesis of dyes and pharmaceuticals. Additionally, 3,5-dimethyl-4-nitrophenol can exhibit antimicrobial properties, which may be of interest in research and industrial applications. However, like many nitrophenols, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₈H₉NO₃

InChI: InChI=1/C8H9NO3/c1-5-3-7(10)4-6(2)8(5)9(11)12/h3-4,10H,1-2H3

SMILES: Cc1cc(cc(C)c1N(=O)=O)O

3,5-Dimethyl-4-nitrophenol

CAS: 5344-97-8

Formula: C₈H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 167.1620

Ref: IN-DA00DAG5

3,5-Dimethyl-4-nitrophenol

CAS: 5344-97-8

3,5-Dimethyl-4-nitrophenol

Purity: 98%

Molecular weight: 167.16g/mol

Ref: 54-OR930942

3,5-Dimethyl-4-nitrophenol

CAS: 5344-97-8

Formula: C₈H₉NO₃

Color and Shape: Neat

Ref: TR-D480393

3,5-DIMETHYL-4-NITROPHENOL

CAS: 5344-97-8

Formula: C₈H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.164

Ref: 10-F334161