CAS 53442-31-2

N-(2-Methylphenyl)-2-thiophenesulfonamide

Description:

N-(2-Methylphenyl)-2-thiophenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a thiophene ring, a five-membered heterocyclic structure containing sulfur, which contributes to its unique chemical reactivity and potential biological activity. The presence of the 2-methylphenyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The sulfonamide moiety is often associated with various pharmacological activities, including antimicrobial effects. Additionally, the compound may exhibit specific interactions with biological targets due to its structural features, making it of interest in medicinal chemistry. Its synthesis typically involves the reaction of thiophenesulfonyl chloride with an amine, leading to the formation of the sulfonamide linkage. As with many sulfonamides, the compound may also be subject to regulatory scrutiny due to its potential effects on human health and the environment. Overall, N-(2-Methylphenyl)-2-thiophenesulfonamide represents a class of compounds with diverse applications in pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₁NO₂S₂

InChI: InChI=1S/C11H11NO2S2/c1-9-5-2-3-6-10(9)12-16(13,14)11-7-4-8-15-11/h2-8,12H,1H3

InChI key: InChIKey=QNIZZBQWDAVWSK-UHFFFAOYSA-N

SMILES: S(NC1=C(C)C=CC=C1)(=O)(=O)C2=CC=CS2

Synonyms:

• N-(2-Methylphenyl)-2-thiophenesulfonamide
• N-(o-Tolyl)-2-thiophenesulfonamide
• 2-Thiophenesulfonamide, N-(2-methylphenyl)-